2-Fluoro-6-(6-methyl-5-(5-methylthiophen-2-yl)-3-phenethylpyrazin-2-yl)phenol

ID: ALA4857145

PubChem CID: 135903265

Max Phase: Preclinical

Molecular Formula: C24H21FN2OS

Molecular Weight: 404.51

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc(-c2nc(CCc3ccccc3)c(-c3cccc(F)c3O)nc2C)s1

Standard InChI:  InChI=1S/C24H21FN2OS/c1-15-11-14-21(29-15)22-16(2)26-23(18-9-6-10-19(25)24(18)28)20(27-22)13-12-17-7-4-3-5-8-17/h3-11,14,28H,12-13H2,1-2H3

Standard InChI Key:  YCTSZTFLLOJXER-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   24.6134   -3.3059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6122   -4.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3203   -4.5344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.0299   -4.1249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0271   -3.3023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3185   -2.8970    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.7348   -4.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7347   -5.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4422   -5.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1503   -5.3476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1464   -4.5262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4383   -4.1225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9042   -4.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9055   -2.8982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8199   -2.0855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0205   -1.9158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6121   -2.6237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1591   -3.2307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.7994   -2.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7333   -2.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4425   -3.2969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1487   -2.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8563   -3.2950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5620   -2.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5594   -2.0664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8452   -1.6606    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1424   -2.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0272   -5.7589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4431   -6.5746    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4  7  1  0
  2 13  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
  1 14  1  0
 17 19  1  0
  5 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
  8 28  1  0
  9 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857145

    ---

Associated Targets(Human)

NR1I2 Tchem Pregnane X receptor (6667 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 404.51Molecular Weight (Monoisotopic): 404.1359AlogP: 6.12#Rotatable Bonds: 5
Polar Surface Area: 46.01Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 6.92CX Basic pKa: CX LogP: 6.41CX LogD: 5.82
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.44Np Likeness Score: -0.73

References

1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW..  (2021)  Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction.,  12  (9.0): [PMID:34531948] [10.1021/acsmedchemlett.1c00187]

Source