The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Fluoro-6-(6-methyl-5-(5-methylthiophen-2-yl)-3-phenethylpyrazin-2-yl)phenol ID: ALA4857145
PubChem CID: 135903265
Max Phase: Preclinical
Molecular Formula: C24H21FN2OS
Molecular Weight: 404.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2nc(CCc3ccccc3)c(-c3cccc(F)c3O)nc2C)s1
Standard InChI: InChI=1S/C24H21FN2OS/c1-15-11-14-21(29-15)22-16(2)26-23(18-9-6-10-19(25)24(18)28)20(27-22)13-12-17-7-4-3-5-8-17/h3-11,14,28H,12-13H2,1-2H3
Standard InChI Key: YCTSZTFLLOJXER-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
24.6134 -3.3059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6122 -4.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3203 -4.5344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.0299 -4.1249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0271 -3.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.3185 -2.8970 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.7348 -4.5317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7347 -5.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4422 -5.7574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1503 -5.3476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1464 -4.5262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4383 -4.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9042 -4.5334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9055 -2.8982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8199 -2.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0205 -1.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6121 -2.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1591 -3.2307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.7994 -2.7094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.7333 -2.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.4425 -3.2969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1487 -2.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8563 -3.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5620 -2.8844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5594 -2.0664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8452 -1.6606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.1424 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0272 -5.7589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.4431 -6.5746 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 7 1 0
2 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
1 14 1 0
17 19 1 0
5 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
8 28 1 0
9 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.51Molecular Weight (Monoisotopic): 404.1359AlogP: 6.12#Rotatable Bonds: 5Polar Surface Area: 46.01Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 6.92CX Basic pKa: ┄CX LogP: 6.41CX LogD: 5.82Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.44Np Likeness Score: -0.73
References 1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW.. (2021) Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction., 12 (9.0): [PMID:34531948 ] [10.1021/acsmedchemlett.1c00187 ]