(9-(2-(Diethylamino)ethyl)-2-methyl-9H-benzo[d]imidazo[1,2-a]imidazole-3-yl)(naphthalen-2-yl)methanone

ID: ALA4857193

PubChem CID: 164613058

Max Phase: Preclinical

Molecular Formula: C27H28N4O

Molecular Weight: 424.55

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)CCn1c2ccccc2n2c(C(=O)c3ccc4ccccc4c3)c(C)nc12

Standard InChI:  InChI=1S/C27H28N4O/c1-4-29(5-2)16-17-30-23-12-8-9-13-24(23)31-25(19(3)28-27(30)31)26(32)22-15-14-20-10-6-7-11-21(20)18-22/h6-15,18H,4-5,16-17H2,1-3H3

Standard InChI Key:  SSMLRKFSJHKWEB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   14.1866   -9.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9885   -9.3308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9619   -8.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6735   -8.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8637   -9.0003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3506   -8.3659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6390   -7.6010    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1259   -6.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4184   -6.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2241   -6.0714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7372   -6.7058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4488   -7.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1610  -11.3528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3846  -11.6060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.9022  -10.9444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3842  -10.2836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1582  -10.5356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9391  -11.6048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4169  -10.9399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9346  -10.2783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0473   -9.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2366   -9.4521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7587  -10.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0915  -10.8631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2341  -10.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1367  -12.3841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3348  -12.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0828  -13.3315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6000  -13.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4098  -13.8355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2850  -13.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0371  -14.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  3 12  2  0
  7 12  1  0
  1  4  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 13 17  1  0
 18 19  1  0
 19 20  2  0
 17 20  1  0
 13 18  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 15 24  2  0
 16 21  2  0
 19 25  1  0
 26 27  1  0
 29 30  1  0
 28 29  1  0
 31 32  1  0
 28 31  1  0
 27 28  1  0
 14 26  1  0
  1 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857193

    ---

Associated Targets(Human)

TRPM2 Tchem Transient receptor potential cation channel subfamily M member 2 (348 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.55Molecular Weight (Monoisotopic): 424.2263AlogP: 5.32#Rotatable Bonds: 7
Polar Surface Area: 42.54Molecular Species: BASEHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.21CX LogP: 4.52CX LogD: 2.72
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.33Np Likeness Score: -1.19

References

1. Zhao S, Zhang H, Jin H, Cai X, Zhang R, Jin Z, Yang W, Yu P, Zhang L, Liu Z..  (2021)  Design, synthesis and biological activities of benzo[d]imidazo[1,2-a]imidazole derivatives as TRPM2-specfic inhibitors.,  225  [PMID:34416664] [10.1016/j.ejmech.2021.113750]

Source