2,6-difluoro-4-(7-(4-morpholinophenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-ylamino)phenol

ID: ALA4857399

PubChem CID: 164613064

Max Phase: Preclinical

Molecular Formula: C22H19F2N5O2

Molecular Weight: 423.42

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(F)cc(Nc2ncc3ccn(-c4ccc(N5CCOCC5)cc4)c3n2)cc1F

Standard InChI:  InChI=1S/C22H19F2N5O2/c23-18-11-15(12-19(24)20(18)30)26-22-25-13-14-5-6-29(21(14)27-22)17-3-1-16(2-4-17)28-7-9-31-10-8-28/h1-6,11-13,30H,7-10H2,(H,25,26,27)

Standard InChI Key:  CACKGVOWAJCUIK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   10.4907   -4.0694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4895   -4.8964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2042   -5.3092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9203   -4.8959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9175   -4.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2023   -3.6567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1998   -2.8320    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7764   -3.6571    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7750   -5.3082    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.6352   -5.3072    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3488   -4.8937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0603   -5.3054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0526   -3.6559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3424   -4.0711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7735   -4.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7762   -4.8887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5683   -5.1433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0554   -4.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5641   -3.7970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8257   -5.9268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2741   -6.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5308   -7.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3389   -7.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8896   -6.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6299   -6.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5972   -8.2717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.0463   -8.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3017   -9.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1086   -9.8337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.6598   -9.2189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4041   -8.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  1  8  1  0
  2  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 17 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 23 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857399

    ---

Associated Targets(Human)

RPS6KA3 Tchem Ribosomal protein S6 kinase alpha 3 (4284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 423.42Molecular Weight (Monoisotopic): 423.1507AlogP: 3.98#Rotatable Bonds: 4
Polar Surface Area: 75.44Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.28CX Basic pKa: 3.93CX LogP: 4.39CX LogD: 4.33
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -1.40

References

1. Casalvieri KA, Matheson CJ, Warfield BM, Backos DS, Reigan P..  (2021)  N-Substituted pyrrolopyrimidines and purines as p90 ribosomal S6 protein kinase-2 (RSK2) inhibitors.,  41  [PMID:34034149] [10.1016/j.bmc.2021.116220]

Source