The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Kirschsteinin B; (+/-)-6-ethyl-3-[1-(5,8-dihydro-1-hydroxy-3,6-dimethoxy-5,8-dioxo-2-naphthalenyl)ethyl]-2,5-dihydroxy-7-methoxy-1,4-naphthalenedione ID: ALA4857434
PubChem CID: 146684299
Max Phase: Preclinical
Molecular Formula: C27H24O10
Molecular Weight: 508.48
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCc1c(OC)cc2c(c1O)C(=O)C(C(C)c1c(OC)cc3c(c1O)C(=O)C=C(OC)C3=O)=C(O)C2=O
Standard InChI: InChI=1S/C27H24O10/c1-6-11-15(35-3)7-13-21(23(11)30)26(33)19(27(34)24(13)31)10(2)18-16(36-4)8-12-20(25(18)32)14(28)9-17(37-5)22(12)29/h7-10,30,32,34H,6H2,1-5H3
Standard InChI Key: AUGCJFLSEXRNSB-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
22.6374 -5.9303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6363 -6.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3507 -7.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.3488 -5.5178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0639 -5.9267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0627 -6.7594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7792 -7.1745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5016 -6.7615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5028 -5.9288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7816 -5.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7769 -7.9991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2145 -7.1758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.3464 -4.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.9217 -7.1690 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.2079 -6.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9232 -5.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2091 -5.9307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7817 -4.6845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2179 -5.5182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9310 -5.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2199 -4.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9369 -4.2847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.9394 -3.4609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5093 -4.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5082 -3.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2282 -3.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.2303 -2.2212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5132 -1.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7925 -2.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7872 -3.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6494 -4.6999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.3652 -4.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7085 -4.0647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.9443 -1.8087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.0732 -3.4646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.5139 -0.9884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2283 -0.5755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
7 11 2 0
8 12 1 0
4 13 1 0
2 14 1 0
14 15 1 0
1 16 1 0
16 17 1 0
10 18 2 0
9 19 1 0
19 20 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 26 2 0
25 24 2 0
24 21 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 25 1 0
22 31 1 0
31 32 1 0
24 33 1 0
27 34 2 0
30 35 2 0
28 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.48Molecular Weight (Monoisotopic): 508.1369AlogP: 3.58#Rotatable Bonds: 6Polar Surface Area: 156.66Molecular Species: ACIDHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.99CX Basic pKa: ┄CX LogP: 3.69CX LogD: 1.18Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.53Np Likeness Score: 1.66
References 1. Flores-Bocanegra L, Raja HA, Bacon JW, Maldonado AC, Burdette JE, Pearce CJ, Oberlies NH.. (2021) Cytotoxic Naphthoquinone Analogues, Including Heterodimers, and Their Structure Elucidation Using LR-HSQMBC NMR Experiments., 84 (3.0): [PMID:33006889 ] [10.1021/acs.jnatprod.0c00856 ]