10-(4-(2-hydroxyethoxy)phenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4857591

PubChem CID: 155088350

Max Phase: Preclinical

Molecular Formula: C24H21NO4

Molecular Weight: 387.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCCC2=C1C(c1ccc(OCCO)cc1)C1=C(N2)c2ccccc2C1=O

Standard InChI:  InChI=1S/C24H21NO4/c26-12-13-29-15-10-8-14(9-11-15)20-21-18(6-3-7-19(21)27)25-23-16-4-1-2-5-17(16)24(28)22(20)23/h1-2,4-5,8-11,20,25-26H,3,6-7,12-13H2

Standard InChI Key:  XZFBDVWZAUUATI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   23.3847  -21.4375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3847  -19.7858    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.0974  -20.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0939  -21.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8034  -21.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5208  -21.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5244  -20.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8103  -19.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6719  -21.0287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6720  -20.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8865  -21.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4012  -20.6158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8872  -19.9494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5529  -19.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7328  -19.1106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2483  -19.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5852  -20.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3847  -22.2617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6683  -22.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6688  -23.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3850  -23.9127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1020  -23.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0980  -22.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7987  -22.2681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.6314  -22.0692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3870  -24.7385    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6727  -25.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6748  -25.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.3909  -26.3901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 10  2  1  0
  9  1  1  0
  1  4  1  0
  3  2  1  0
  3  4  2  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9 10  2  0
 10 13  1  0
 12 11  1  0
 11  9  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
  1 18  1  0
  5 24  2  0
 11 25  2  0
 21 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857591

    ---

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 387.44Molecular Weight (Monoisotopic): 387.1471AlogP: 3.36#Rotatable Bonds: 4
Polar Surface Area: 75.63Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.06CX LogD: 2.06
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.84Np Likeness Score: -0.42

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source