The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-((5-chloro-2-((4-(4-methylpiperidin-1-yl)phenyl)amino)pyrimidin-4-yl)oxy)phenyl)propionamide ID: ALA4857660
PubChem CID: 164614704
Max Phase: Preclinical
Molecular Formula: C25H28ClN5O2
Molecular Weight: 465.99
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCC(C)CC4)cc3)ncc2Cl)c1
Standard InChI: InChI=1S/C25H28ClN5O2/c1-3-23(32)28-19-5-4-6-21(15-19)33-24-22(26)16-27-25(30-24)29-18-7-9-20(10-8-18)31-13-11-17(2)12-14-31/h4-10,15-17H,3,11-14H2,1-2H3,(H,28,32)(H,27,29,30)
Standard InChI Key: VOEPHFPOPCDLEQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
39.3600 -2.6166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.3588 -3.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0669 -3.8451 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
40.7765 -3.4357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7737 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0651 -2.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.6508 -3.8442 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
37.9434 -3.4350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4849 -3.8432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.1919 -3.4335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9486 -2.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2420 -2.2089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5330 -2.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5350 -3.4384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2421 -3.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8970 -3.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6035 -3.4324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.6027 -2.6143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.8894 -2.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.1857 -2.6184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
44.3117 -3.8402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
45.0190 -3.4308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.7271 -3.8387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4344 -3.4293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
45.0181 -2.6136 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8251 -2.2088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.8247 -1.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1176 -2.6177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1167 -0.9834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4097 -2.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4092 -1.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7013 -0.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.4799 -2.2018 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
8 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 8 1 0
10 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 10 1 0
17 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
22 25 2 0
13 26 1 0
26 27 1 0
26 28 1 0
27 29 1 0
28 30 1 0
30 31 1 0
29 31 1 0
31 32 1 0
5 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 465.99Molecular Weight (Monoisotopic): 465.1932AlogP: 6.25#Rotatable Bonds: 7Polar Surface Area: 79.38Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.68CX Basic pKa: 6.35CX LogP: 6.05CX LogD: 6.01Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.43Np Likeness Score: -1.76
References 1. Yang H, Wang X, Wang C, Yin F, Qu L, Shi C, Zhao J, Li S, Ji L, Peng W, Luo H, Cheng M, Kong L.. (2021) Optimization of WZ4003 as NUAK inhibitors against human colorectal cancer., 210 [PMID:33310286 ] [10.1016/j.ejmech.2020.113080 ]