N-(4-(((5-Isopropylpyrimidin-2-yl)amino)methyl)benzyl)-[1,2,4]-triazolo[4,3-a]pyridine-6-carboxamide

ID: ALA4857671

PubChem CID: 164615239

Max Phase: Preclinical

Molecular Formula: C22H23N7O

Molecular Weight: 401.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)c1cnc(NCc2ccc(CNC(=O)c3ccc4nncn4c3)cc2)nc1

Standard InChI:  InChI=1S/C22H23N7O/c1-15(2)19-11-25-22(26-12-19)24-10-17-5-3-16(4-6-17)9-23-21(30)18-7-8-20-28-27-14-29(20)13-18/h3-8,11-15H,9-10H2,1-2H3,(H,23,30)(H,24,25,26)

Standard InChI Key:  PUOHNKDLOSLJPB-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
   11.3771  -11.2880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3771  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6722  -10.0622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9631  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2540  -10.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2540   -9.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5490   -8.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8399   -9.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1350   -8.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4259   -9.2450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7168   -8.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7168   -8.0192    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0077   -7.6106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3027   -8.0192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3027   -8.8364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0077   -9.2450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8399  -10.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5490  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0862  -10.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7953  -10.4708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5003  -10.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0862   -9.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7953   -8.8364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.5003   -9.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1109   -8.6971    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.7765   -7.9499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9661   -8.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5947   -7.6112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5940   -6.7940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8873   -8.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 11 16  1  0
  8 17  1  0
 17 18  2  0
  5 18  1  0
  2 19  1  0
 19 20  1  0
 20 21  2  0
 19 22  2  0
 22 23  1  0
 23 24  1  0
 21 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 23 27  1  0
 14 28  1  0
 28 29  1  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857671

    ---

Associated Targets(Human)

MLLT1 Tchem Protein ENL (186 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.47Molecular Weight (Monoisotopic): 401.1964AlogP: 3.18#Rotatable Bonds: 7
Polar Surface Area: 97.10Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.86CX Basic pKa: 3.15CX LogP: 1.80CX LogD: 1.80
Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.49Np Likeness Score: -1.75

References

1. Ma XR, Xu L, Xu S, Klein BJ, Wang H, Das S, Li K, Yang KS, Sohail S, Chapman A, Kutateladze TG, Shi X, Liu WR, Wen H..  (2021)  Discovery of Selective Small-Molecule Inhibitors for the ENL YEATS Domain.,  64  (15.0): [PMID:34279931] [10.1021/acs.jmedchem.1c00367]

Source