(E)-4-(3-(5-hydroxy-7-methoxy-2,2-dimethylchroman-6-yl)-3-oxoprop-1-enyl)phenyl acetate

ID: ALA4857693

PubChem CID: 164615853

Max Phase: Preclinical

Molecular Formula: C23H24O6

Molecular Weight: 396.44

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(c(O)c1C(=O)/C=C/c1ccc(OC(C)=O)cc1)CCC(C)(C)O2

Standard InChI:  InChI=1S/C23H24O6/c1-14(24)28-16-8-5-15(6-9-16)7-10-18(25)21-20(27-4)13-19-17(22(21)26)11-12-23(2,3)29-19/h5-10,13,26H,11-12H2,1-4H3/b10-7+

Standard InChI Key:  DXHNGOOJCJDQLI-JXMROGBWSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   30.9295  -14.4824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7219  -14.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1434  -13.6909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7219  -15.0891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4272  -15.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4272  -13.8592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.1324  -14.2720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1308  -15.0873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8351  -15.4946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5414  -15.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5390  -14.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8342  -13.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2495  -15.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2503  -16.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9568  -15.0862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6649  -15.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3722  -15.0848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0764  -15.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7832  -15.0852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7828  -14.2671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.0697  -13.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3658  -14.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2454  -13.8583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.2428  -13.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8344  -16.3118    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4896  -13.8569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.1982  -14.2638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.9050  -13.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2001  -15.0810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  2  4  1  0
  2  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 11 23  1  0
 23 24  1  0
  9 25  1  0
 20 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4857693

    ---

Associated Targets(Human)

NFKB2 Tchem Nuclear factor NF-kappa-B complex (2307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 396.44Molecular Weight (Monoisotopic): 396.1573AlogP: 4.33#Rotatable Bonds: 5
Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.48CX Basic pKa: CX LogP: 4.71CX LogD: 4.45
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.35Np Likeness Score: 1.19

References

1. Ajiaikebaier D, Li Z, Lin T, Sun X, Wang B, Li J..  (2021)  Synthesis of pyranochalcone derivatives and their inhibitory effect on NF-κB activation.,  42  [PMID:33862226] [10.1016/j.bmcl.2021.128042]

Source