N-(4-(N-Benzoylsulfamoyl)phenyl)-2,4-dichlorobenzamide

ID: ALA4857734

PubChem CID: 164617533

Max Phase: Preclinical

Molecular Formula: C20H14Cl2N2O4S

Molecular Weight: 449.32

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(NS(=O)(=O)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1)c1ccccc1

Standard InChI:  InChI=1S/C20H14Cl2N2O4S/c21-14-6-11-17(18(22)12-14)20(26)23-15-7-9-16(10-8-15)29(27,28)24-19(25)13-4-2-1-3-5-13/h1-12H,(H,23,26)(H,24,25)

Standard InChI Key:  LGGOIGYZPIHYDT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
    8.1719   -5.0270    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5846   -5.7368    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.9931   -5.0245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0553   -6.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3462   -7.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6371   -6.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9322   -7.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9322   -8.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6371   -8.5968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3462   -8.1882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0553   -6.1452    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7603   -7.3710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4694   -6.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1785   -7.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8834   -6.9624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8834   -6.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1785   -5.7366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4694   -6.1452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3019   -6.1370    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2231   -8.5968    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.6371   -6.1452    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.0035   -5.7180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7171   -6.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7276   -6.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4404   -7.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1430   -6.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1283   -6.0884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4150   -5.6940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9915   -4.9009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  4 11  2  0
  4 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 13 18  2  0
  2 19  1  0
 16  2  1  0
 12 13  1  0
  8 20  1  0
  6 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 23  1  0
 22 29  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4857734

    ---

Associated Targets(Human)

GPR27 Tbio Probable G-protein coupled receptor 27 (65 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.32Molecular Weight (Monoisotopic): 448.0051AlogP: 4.36#Rotatable Bonds: 5
Polar Surface Area: 92.34Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.30CX Basic pKa: CX LogP: 4.72CX LogD: 3.78
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.61Np Likeness Score: -1.61

References

1. Pillaiyar T, Rosato F, Wozniak M, Blavier J, Charles M, Laschet C, Kronenberger T, Müller CE, Hanson J..  (2021)  Structure-activity relationships of agonists for the orphan G protein-coupled receptor GPR27.,  225  [PMID:34454125] [10.1016/j.ejmech.2021.113777]

Source