The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(1H-Indol-3-yl)-2-oxo-2-(phenethylamino)ethyl)-2-chloro-N-(4-cyanophenyl)acetamide ID: ALA4857735
PubChem CID: 164617534
Max Phase: Preclinical
Molecular Formula: C27H23ClN4O2
Molecular Weight: 470.96
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: N#Cc1ccc(N(C(=O)CCl)C(C(=O)NCCc2ccccc2)c2c[nH]c3ccccc23)cc1
Standard InChI: InChI=1S/C27H23ClN4O2/c28-16-25(33)32(21-12-10-20(17-29)11-13-21)26(23-18-31-24-9-5-4-8-22(23)24)27(34)30-15-14-19-6-2-1-3-7-19/h1-13,18,26,31H,14-16H2,(H,30,34)
Standard InChI Key: ZJNUDHWUWAERDJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
12.4712 -23.9121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4701 -24.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1847 -25.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1829 -23.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8982 -23.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9031 -24.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6947 -24.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1793 -24.3164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6869 -23.6473 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9520 -25.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4015 -26.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6580 -27.1680 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4653 -27.3391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0157 -26.7234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7589 -25.9369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3079 -25.3212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7228 -28.1226 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.1082 -27.7829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5941 -26.2191 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8230 -26.8930 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.1146 -25.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6633 -24.8794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4048 -24.0950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5924 -23.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0472 -24.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3008 -27.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7509 -28.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9438 -28.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3944 -28.6723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6517 -29.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4639 -29.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0099 -29.0086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9481 -23.4776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4962 -22.8612 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 1 0
10 11 1 0
10 15 1 0
11 12 1 0
13 14 1 0
14 15 1 0
7 10 1 0
15 16 1 0
13 17 1 0
12 18 1 0
11 19 2 0
14 20 2 0
16 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 16 1 0
18 26 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 27 1 0
33 34 3 0
23 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 470.96Molecular Weight (Monoisotopic): 470.1510AlogP: 4.71#Rotatable Bonds: 8Polar Surface Area: 88.99Molecular Species: NEUTRALHBA: 3HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.41CX LogD: 4.41Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: -1.16
References 1. Xu C, Xiao Z, Wang J, Lai H, Zhang T, Guan Z, Xia M, Chen M, Ren L, He Y, Gao Y, Zhao C.. (2021) Discovery of a Potent Glutathione Peroxidase 4 Inhibitor as a Selective Ferroptosis Inducer., 64 (18.0): [PMID:34506134 ] [10.1021/acs.jmedchem.1c00569 ]