(R)-N-([1,1'-Biphenyl]-4-ylmethyl)-N-cyclopropyl-1-(3-((2-methyl-1-oxo-1-(piperazin-1-yl)propan-2-yl)oxy)phenyl)-piperidine-3-carboxamide Hydrochloride salt

ID: ALA4857780

PubChem CID: 164609803

Max Phase: Preclinical

Molecular Formula: C36H45ClN4O3

Molecular Weight: 580.77

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(Oc1cccc(N2CCC[C@@H](C(=O)N(Cc3ccc(-c4ccccc4)cc3)C3CC3)C2)c1)C(=O)N1CCNCC1.Cl

Standard InChI:  InChI=1S/C36H44N4O3.ClH/c1-36(2,35(42)38-22-19-37-20-23-38)43-33-12-6-11-32(24-33)39-21-7-10-30(26-39)34(41)40(31-17-18-31)25-27-13-15-29(16-14-27)28-8-4-3-5-9-28;/h3-6,8-9,11-16,24,30-31,37H,7,10,17-23,25-26H2,1-2H3;1H/t30-;/m1./s1

Standard InChI Key:  LVOZDVLPIJSBNF-VNUFCWELSA-N

Molfile:  

     RDKit          2D

 44 48  0  0  0  0  0  0  0  0999 V2000
   14.5848   -8.9866    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.6873   -5.9374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4748   -6.7374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2739   -6.5215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8911   -7.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6536   -6.7416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2411   -6.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4161   -6.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0036   -5.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4161   -4.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2411   -4.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6536   -5.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1786   -5.3140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.7661   -6.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9412   -6.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5287   -5.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9412   -4.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7661   -4.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5287   -6.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9412   -7.4574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.7037   -6.7416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5287   -8.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7037   -8.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2912   -8.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4662   -8.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0537   -8.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4662   -7.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2912   -7.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4790   -8.1722    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.7161   -7.4569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.1227   -8.1724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9441   -8.1738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3600   -7.4609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.9483   -6.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1207   -6.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7661   -7.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4789   -7.8647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4789   -7.0397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2315   -8.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8187   -7.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9945   -7.4621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5821   -8.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9999   -8.8939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8227   -8.8896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0
  4  3  1  0
  5  3  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  7 12  2  0
  6  7  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 13 18  1  0
 19 20  1  0
 19 21  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
 20 22  1  0
 15 19  1  6
  9 13  1  0
  3  6  1  0
  5 29  2  0
  5 30  1  0
 30 31  1  0
 30 35  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 20 36  1  0
 37 36  1  0
 38 37  1  0
 36 38  1  0
 39 40  2  0
 40 41  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 39  1  0
 26 39  1  0
M  END

Associated Targets(Human)

CTNNB1 Tchem beta-catenin-B-cell lymphoma 9 protein complex (525 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 580.77Molecular Weight (Monoisotopic): 580.3413AlogP: 5.35#Rotatable Bonds: 9
Polar Surface Area: 65.12Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 7.82CX LogP: 5.21CX LogD: 4.65
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.37Np Likeness Score: -1.41

References

1. Wang Z, Zhang M, Quereda V, Frydman SM, Ming Q, Luca VC, Duckett DR, Ji H..  (2021)  Discovery of an Orally Bioavailable Small-Molecule Inhibitor for the β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction.,  64  (16.0): [PMID:34382808] [10.1021/acs.jmedchem.1c00742]

Source