The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-butyl 4-((6-((1-(methylsulfonyl)azetidin-3-yl)methoxy)pyrimidin-4-yl)(trifluoromethyl)amino)piperidine-1-carboxylate ID: ALA4857801
PubChem CID: 164609814
Max Phase: Preclinical
Molecular Formula: C20H30F3N5O5S
Molecular Weight: 509.55
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCC(N(c2cc(OCC3CN(S(C)(=O)=O)C3)ncn2)C(F)(F)F)CC1
Standard InChI: InChI=1S/C20H30F3N5O5S/c1-19(2,3)33-18(29)26-7-5-15(6-8-26)28(20(21,22)23)16-9-17(25-13-24-16)32-12-14-10-27(11-14)34(4,30)31/h9,13-15H,5-8,10-12H2,1-4H3
Standard InChI Key: IZDPDUJOLKDUOB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
1.1432 -9.9838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9328 -9.1955 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3553 -9.7719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3465 -11.2838 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.6407 -10.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6397 -11.6907 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4324 -9.0675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4366 -9.8847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1422 -9.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0100 -9.0508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5518 -9.6588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3509 -9.4912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6059 -8.7139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0557 -8.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2587 -8.2747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8960 -10.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6958 -9.9323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2393 -10.5466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0361 -10.3816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2948 -9.6061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7505 -8.9953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9475 -9.1600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0953 -9.4414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6381 -10.0523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3529 -8.6659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9813 -10.4985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8415 -11.0442 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2106 -9.2203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6641 -8.6127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8647 -8.7822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1807 -8.3423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7353 -9.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4204 -9.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3893 -8.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
5 4 1 0
6 5 1 0
8 7 1 0
9 8 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
12 16 1 0
16 17 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
20 23 1 0
23 24 1 0
23 25 2 0
24 8 1 0
8 26 1 0
16 5 1 0
5 27 1 0
10 28 1 0
29 28 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 30 1 0
32 2 1 0
2 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 509.55Molecular Weight (Monoisotopic): 509.1920AlogP: 2.47#Rotatable Bonds: 6Polar Surface Area: 105.17Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 4.65CX LogP: 2.33CX LogD: 2.33Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.54Np Likeness Score: -1.44
References 1. Kubo O, Takami K, Kamaura M, Watanabe K, Miyashita H, Abe S, Matsuda K, Tsujihata Y, Odani T, Iwasaki S, Kitazaki T, Murata T, Sato K.. (2021) Discovery of a novel series of GPR119 agonists: Design, synthesis, and biological evaluation of N-(Piperidin-4-yl)-N-(trifluoromethyl)pyrimidin-4-amine derivatives., 41 [PMID:34010766 ] [10.1016/j.bmc.2021.116208 ]