5-((E)-7'-Methoxy-2,2,2',2'-tetramethyl-2,3,2',3'-tetrahydro-[4,4']bichromenyliden-7-yloxy)-pentanoic acid (4-methylamino-butyl)-amide

ID: ALA4857873

PubChem CID: 164610343

Max Phase: Preclinical

Molecular Formula: C33H46N2O5

Molecular Weight: 550.74

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCCCNC(=O)CCCCOc1ccc2c(c1)OC(C)(C)C/C2=C1/CC(C)(C)Oc2cc(OC)ccc21

Standard InChI:  InChI=1S/C33H46N2O5/c1-32(2)21-27(25-14-12-23(37-6)19-29(25)39-32)28-22-33(3,4)40-30-20-24(13-15-26(28)30)38-18-10-7-11-31(36)35-17-9-8-16-34-5/h12-15,19-20,34H,7-11,16-18,21-22H2,1-6H3,(H,35,36)/b28-27+

Standard InChI Key:  NXKTXQPBJPFMFO-BYYHNAKLSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   25.2256  -13.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0469  -13.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6378  -12.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2922  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4708  -16.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8794  -17.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6258  -15.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6246  -16.5442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3368  -16.9573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3350  -15.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0477  -15.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0466  -16.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7569  -16.9549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.4741  -15.7190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7592  -15.3054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9125  -16.9564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.2009  -16.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7592  -14.4841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.7646  -12.8456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.0473  -14.0769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4746  -13.2580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.4724  -14.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1716  -14.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8776  -14.0735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8759  -13.2563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.1720  -12.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.5868  -12.8460    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.2996  -13.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0104  -12.8426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7233  -13.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4341  -12.8392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.1418  -13.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.8495  -12.8394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.1417  -14.0651    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.5572  -13.2480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.2649  -12.8395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.9726  -13.2482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.6804  -12.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3880  -13.2483    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.0958  -12.8398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 11 15  1  0
 12 13  1  0
 13  5  1  0
  5 14  1  0
 14 15  1  0
  8 16  1  0
 16 17  1  0
 15 18  2  0
 18 22  1  0
 18 20  1  0
 21 19  1  0
 19  2  1  0
  2 20  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857873

    ---

Associated Targets(Human)

PA-1 (704 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MCF7 (126967 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MDA-MB-231 (73002 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 550.74Molecular Weight (Monoisotopic): 550.3407AlogP: 6.39#Rotatable Bonds: 12
Polar Surface Area: 78.05Molecular Species: BASEHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 10.24CX LogP: 4.81CX LogD: 2.11
Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.30Np Likeness Score: 0.08

References

1. Agarwal K, Gupta K, Sharma K, Khanka S, Singh S, Singh J, Trivedi L, Vasdev PG, Luqman S, Khan F, Singh D, Gupta A..  (2021)  Synthesis and biological evaluation of substituted amide derivatives of C4-ageratochromene dimer analog.,  50  [PMID:34469711] [10.1016/j.bmcl.2021.128340]

Source