The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
10-(4-methoxyphenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione ID: ALA4857874
Max Phase: Preclinical
Molecular Formula: C23H19NO3
Molecular Weight: 357.41
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc23)cc1
Standard InChI: InChI=1S/C23H19NO3/c1-27-14-11-9-13(10-12-14)19-20-17(7-4-8-18(20)25)24-22-15-5-2-3-6-16(15)23(26)21(19)22/h2-3,5-6,9-12,19,24H,4,7-8H2,1H3
Standard InChI Key: GJSZIRGDKVNMQC-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 31 0 0 0 0 0 0 0 0999 V2000
40.7924 -5.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7924 -3.6156 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
41.5050 -4.0325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5015 -4.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2108 -5.2718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9283 -4.8643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.9317 -4.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2179 -3.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0797 -4.8583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0797 -4.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2944 -5.1133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.8091 -4.4454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.2951 -3.7790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.9607 -3.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.1409 -2.9405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6564 -3.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9932 -4.3609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7924 -6.0911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0761 -6.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.0766 -7.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7927 -7.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5097 -7.3239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5056 -6.5003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.7947 -8.5676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
40.0805 -8.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
42.2061 -6.0975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
39.0393 -5.8986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10 2 1 0
9 1 1 0
1 4 1 0
3 2 1 0
3 4 2 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
9 10 2 0
10 13 1 0
12 11 1 0
11 9 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
1 18 1 0
21 24 1 0
24 25 1 0
5 26 2 0
11 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 357.41Molecular Weight (Monoisotopic): 357.1365AlogP: 4.00#Rotatable Bonds: 2Polar Surface Area: 55.40Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.75CX LogD: 2.75Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.88Np Likeness Score: -0.48
References 1. (2020) Inhibitors of GPR174 and Uses Thereof, 2. (2020) Methods and Compositions for Treating Cancer,