The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,3-dichlorophenyl)-3-hydroxy-9-(1-methylpiperidin-4-yl)-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one ID: ALA4857894
PubChem CID: 164609849
Max Phase: Preclinical
Molecular Formula: C23H22Cl2N2O4
Molecular Weight: 461.35
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCC(N2COc3ccc4c(=O)c(O)c(-c5cccc(Cl)c5Cl)oc4c3C2)CC1
Standard InChI: InChI=1S/C23H22Cl2N2O4/c1-26-9-7-13(8-10-26)27-11-16-18(30-12-27)6-5-15-20(28)21(29)23(31-22(15)16)14-3-2-4-17(24)19(14)25/h2-6,13,29H,7-12H2,1H3
Standard InChI Key: WYGBAWJOCJZOAY-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
1.9893 -15.6742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7041 -16.0871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4177 -14.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4166 -15.6716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1296 -16.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8482 -15.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8494 -14.8452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1319 -14.4276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1272 -16.9097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5616 -16.0882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.5631 -14.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2769 -14.8533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9919 -14.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9944 -13.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2758 -13.2031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5637 -13.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9904 -14.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7037 -14.4358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7044 -13.6171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9935 -13.2031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2802 -13.6141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2778 -14.4391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9990 -12.3805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7164 -11.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7202 -11.1493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0084 -10.7314 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2912 -11.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2857 -11.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0135 -9.9063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8491 -13.2033 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.2749 -12.3781 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
17 1 2 0
1 2 1 0
2 4 2 0
3 18 2 0
3 4 1 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
5 9 2 0
6 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 11 1 0
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
20 23 1 0
26 29 1 0
16 30 1 0
15 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 461.35Molecular Weight (Monoisotopic): 460.0957AlogP: 4.72#Rotatable Bonds: 2Polar Surface Area: 66.15Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.59CX Basic pKa: 7.77CX LogP: 3.31CX LogD: 3.05Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.25
References 1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P.. (2021) Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment., 64 (20.0): [PMID:34644502 ] [10.1021/acs.jmedchem.1c00087 ]