Tert-butyl 7-((6-(2-bromo-4-fluorophenyl)-5-(ethoxycarbonyl)-2-(thiazol-2-yl)-3,6-dihydropyrimidin-4-yl)methyl)-2,7-diazaspiro[4.4]nonane-2-carboxylate

ID: ALA4857897

PubChem CID: 164609852

Max Phase: Preclinical

Molecular Formula: C29H35BrFN5O4S

Molecular Weight: 648.60

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)C1=C(CN2CCC3(CCN(C(=O)OC(C)(C)C)C3)C2)NC(c2nccs2)=NC1c1ccc(F)cc1Br

Standard InChI:  InChI=1S/C29H35BrFN5O4S/c1-5-39-26(37)22-21(15-35-11-8-29(16-35)9-12-36(17-29)27(38)40-28(2,3)4)33-24(25-32-10-13-41-25)34-23(22)19-7-6-18(31)14-20(19)30/h6-7,10,13-14,23H,5,8-9,11-12,15-17H2,1-4H3,(H,33,34)

Standard InChI Key:  CFLAUADCAKQMJD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
    7.4249  -23.1909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8471  -22.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6356  -23.4024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5853  -22.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3707  -22.8238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0541  -23.2715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6912  -22.7599    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4014  -21.9961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864  -18.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8853  -19.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5933  -19.9578    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3030  -19.5484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3002  -18.7257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5915  -18.3205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1786  -18.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1784  -17.5037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4710  -18.7297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7632  -18.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0556  -18.7300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1773  -19.9569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1766  -20.7741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5863  -17.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2944  -17.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2923  -16.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5829  -15.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8740  -16.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8796  -17.1025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0118  -19.9535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0986  -20.7660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.8982  -20.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3057  -20.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7579  -19.6200    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0029  -17.5032    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.5793  -15.0551    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.5187  -21.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7707  -22.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8409  -21.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4797  -22.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6880  -23.7647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0598  -22.3990    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4284  -22.0381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  4  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14  9  1  0
  9 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 10 20  1  0
 20 21  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 14 22  1  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  2  0
 12 28  1  0
 23 33  1  0
 25 34  1  0
 21 35  1  0
 35 36  1  0
 36  4  1  0
  4 37  1  0
 37 21  1  0
  7 38  1  0
 38 39  2  0
 38 40  1  0
 40  2  1  0
  2 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4857897

    ---

Associated Targets(non-human)

HBcAg Core antigen (581 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 648.60Molecular Weight (Monoisotopic): 647.1577AlogP: 5.29#Rotatable Bonds: 6
Polar Surface Area: 96.36Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.74CX LogP: 4.16CX LogD: 4.08
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.43Np Likeness Score: -1.35

References

1. Ma Y, Zhao S, Ren Y, Cherukupalli S, Li Q, Woodson ME, Bradley DP, Tavis JE, Liu X, Zhan P..  (2021)  Design, synthesis and evaluation of heteroaryldihydropyrimidine analogues bearing spiro ring as hepatitis B virus capsid protein inhibitors.,  225  [PMID:34438123] [10.1016/j.ejmech.2021.113780]

Source