The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(5-(4-((4-ethylpiperazin-1-yl)methyl)-3-(trifluoromethyl)benzamido)-2-methylphenyl)-1-methyl-1H-pyrazole-3-carboxamide ID: ALA4857910
PubChem CID: 164610346
Max Phase: Preclinical
Molecular Formula: C27H31F3N6O2
Molecular Weight: 528.58
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCN1CCN(Cc2ccc(C(=O)Nc3ccc(C)c(NC(=O)c4ccn(C)n4)c3)cc2C(F)(F)F)CC1
Standard InChI: InChI=1S/C27H31F3N6O2/c1-4-35-11-13-36(14-12-35)17-20-7-6-19(15-22(20)27(28,29)30)25(37)31-21-8-5-18(2)24(16-21)32-26(38)23-9-10-34(3)33-23/h5-10,15-16H,4,11-14,17H2,1-3H3,(H,31,37)(H,32,38)
Standard InChI Key: SIMHYJSDPAPVBS-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
34.4485 -24.1930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.8529 -23.4861 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.0357 -23.4903 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
28.7943 -23.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7931 -24.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.5012 -24.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2108 -24.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.2080 -23.3854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.4994 -22.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0864 -22.9805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0858 -24.6148 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3790 -24.2046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6704 -24.6117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.9192 -24.6155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.9221 -24.2728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.3740 -24.8788 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5807 -25.4192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7800 -25.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.6262 -24.2058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3346 -24.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.3312 -25.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0388 -25.8363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7468 -25.4266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7429 -24.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.0348 -24.2015 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1583 -24.5979 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
34.4557 -25.8331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4581 -26.6503 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
33.7444 -27.0578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.7448 -27.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4519 -28.2818 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.1602 -27.8724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1615 -27.0526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4512 -29.0990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1585 -29.5082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.3808 -23.3874 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.6293 -23.3886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.5615 -24.7906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 3 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
4 10 1 0
5 11 1 0
11 12 1 0
12 13 1 0
7 14 1 0
13 15 2 0
15 16 1 0
16 18 1 0
17 13 1 0
17 18 2 0
14 19 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
24 1 1 0
1 26 1 0
23 27 1 0
27 28 1 0
28 29 1 0
28 33 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
31 34 1 0
34 35 1 0
12 36 2 0
19 37 2 0
16 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 528.58Molecular Weight (Monoisotopic): 528.2461AlogP: 4.39#Rotatable Bonds: 7Polar Surface Area: 82.50Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.83CX LogP: 4.51CX LogD: 3.94Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.48Np Likeness Score: -2.15
References 1. Lee JW, Park J, Kim J, Kim J, Choi C, Min KH.. (2021) Discovery of potent colony-stimulating factor 1 receptor inhibitors by replacement of hinge-binder moieties., 216 [PMID:33689933 ] [10.1016/j.ejmech.2021.113298 ]