The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-Methyl-1,3-dioctyl-4,9-dioxo-4,9-dihydro-1H-naphtho[2,3-d]imidazol-3-ium bromide ID: ALA4858055
PubChem CID: 164610381
Max Phase: Preclinical
Molecular Formula: C28H41BrN2O2
Molecular Weight: 437.65
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCn1c2c([n+](CCCCCCCC)c1C)C(=O)c1ccccc1C2=O.[Br-]
Standard InChI: InChI=1S/C28H41N2O2.BrH/c1-4-6-8-10-12-16-20-29-22(3)30(21-17-13-11-9-7-5-2)26-25(29)27(31)23-18-14-15-19-24(23)28(26)32;/h14-15,18-19H,4-13,16-17,20-21H2,1-3H3;1H/q+1;/p-1
Standard InChI Key: LDBWINBGAGIDKC-UHFFFAOYSA-M
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
16.1121 -5.3602 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9.2192 -5.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2181 -6.5439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9329 -6.9568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9311 -5.3038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6465 -5.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6453 -6.5460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3622 -6.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3646 -5.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0860 -5.7150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0827 -6.5462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8723 -6.8061 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.3635 -6.1356 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8775 -5.4613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3612 -7.7862 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.3646 -4.4701 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.1885 -6.1388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1240 -7.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1355 -4.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9303 -7.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.1820 -8.5521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9884 -8.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2401 -9.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9432 -4.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2012 -3.7258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0089 -3.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2669 -2.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0745 -2.6055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0465 -9.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3326 -1.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1402 -1.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2982 -10.4729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1045 -10.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 7 2 0
6 5 2 0
5 2 1 0
6 7 1 0
6 9 1 0
7 8 1 0
8 11 1 0
10 9 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
8 15 2 0
9 16 2 0
13 17 1 0
12 18 1 0
14 19 1 0
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
19 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
23 29 1 0
28 30 1 0
30 31 1 0
29 32 1 0
32 33 1 0
M CHG 2 1 -1 14 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 437.65Molecular Weight (Monoisotopic): 437.3163AlogP: 6.58#Rotatable Bonds: 14Polar Surface Area: 42.95Molecular Species: ┄HBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.16CX LogD: 3.16Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.21Np Likeness Score: -0.03
References 1. Fridianto KT, Li M, Hards K, Negatu DA, Cook GM, Dick T, Lam Y, Go ML.. (2021) Functionalized Dioxonaphthoimidazoliums: A Redox Cycling Chemotype with Potent Bactericidal Activities against Mycobacterium tuberculosis ., 64 (21.0): [PMID:34706190 ] [10.1021/acs.jmedchem.1c01383 ]