The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3S)-3-(4-Aminobutyl)-4-hydroxy-1-[2-(6-methoxypyridin-3-yl)benzyl]-4-oxo-1,4-azaphosphinane-3-carboxylic Acid ID: ALA4858095
PubChem CID: 135365123
Max Phase: Preclinical
Molecular Formula: C22H30N3O5P
Molecular Weight: 447.47
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccccc2CN2CCP(=O)(O)[C@](CCCCN)(C(=O)O)C2)cn1
Standard InChI: InChI=1S/C22H30N3O5P/c1-30-20-9-8-17(14-24-20)19-7-3-2-6-18(19)15-25-12-13-31(28,29)22(16-25,21(26)27)10-4-5-11-23/h2-3,6-9,14H,4-5,10-13,15-16,23H2,1H3,(H,26,27)(H,28,29)/t22-/m0/s1
Standard InChI Key: AVHRAGMQIMFUSI-QFIPXVFZSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
4.4450 -11.2921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8619 -12.0102 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.2744 -11.2896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9845 -11.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5759 -12.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4012 -12.4224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1520 -12.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1520 -13.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8655 -13.6611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5791 -13.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6255 -11.0283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8099 -11.7043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8137 -13.1278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6309 -13.1232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0435 -13.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8607 -13.8240 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8655 -14.4783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1578 -14.8869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4494 -14.4775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7421 -14.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7417 -15.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4544 -16.1119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1587 -15.7016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8646 -16.1044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8652 -16.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5731 -17.3295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2808 -16.9191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2762 -16.0977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5677 -15.6946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9901 -17.3250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6962 -16.9138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
5 4 1 0
5 6 1 1
7 8 1 0
7 2 1 0
8 9 1 0
9 10 1 0
10 5 1 0
5 2 1 0
4 11 2 0
4 12 1 0
6 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
9 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
23 24 1 0
27 30 1 0
30 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.47Molecular Weight (Monoisotopic): 447.1923AlogP: 2.80#Rotatable Bonds: 9Polar Surface Area: 125.98Molecular Species: ZWITTERIONHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 0.60CX Basic pKa: 10.52CX LogP: -5.06CX LogD: -4.98Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -0.40
References 1. Schaffner AP, Sansilvestri-Morel P, Despaux N, Ruano E, Persigand T, Rupin A, Mennecier P, Vallez MO, Raimbaud E, Desos P, Gloanec P.. (2021) Phosphinanes and Azaphosphinanes as Potent and Selective Inhibitors of Activated Thrombin-Activatable Fibrinolysis Inhibitor (TAFIa)., 64 (7.0): [PMID:33764059 ] [10.1021/acs.jmedchem.0c02072 ]