(E)-6-(3-(4-hydroxyphenyl)acryloyl)-7-methoxy-2,2-dimethylchroman-5-yl acrylate

ID: ALA4858174

PubChem CID: 164610924

Max Phase: Preclinical

Molecular Formula: C24H24O6

Molecular Weight: 408.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)Oc1c2c(cc(OC)c1C(=O)/C=C/c1ccc(O)cc1)OC(C)(C)CC2

Standard InChI:  InChI=1S/C24H24O6/c1-5-21(27)29-23-17-12-13-24(2,3)30-19(17)14-20(28-4)22(23)18(26)11-8-15-6-9-16(25)10-7-15/h5-11,14,25H,1,12-13H2,2-4H3/b11-8+

Standard InChI Key:  LTIPKVHQIFLZGQ-DHZHZOJOSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
    3.3719  -24.3589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1644  -24.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5859  -23.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1644  -24.9656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8697  -25.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8697  -23.7357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5749  -24.1484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5733  -24.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2776  -25.3711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9838  -24.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9815  -24.1456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2767  -23.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6920  -25.3720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6928  -26.1892    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3993  -24.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1074  -25.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8147  -24.9613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5189  -25.3702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2257  -24.9616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2253  -24.1436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5122  -23.7358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8083  -24.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6879  -23.7348    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6853  -22.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2769  -26.1883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9321  -23.7333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5689  -26.5963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8615  -26.1871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5682  -27.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8602  -27.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  2  4  1  0
  2  6  1  0
  4  5  1  0
  5  8  1  0
  7  6  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 11 23  1  0
 23 24  1  0
  9 25  1  0
 20 26  1  0
 25 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA4858174

    ---

Associated Targets(Human)

NFKB2 Tchem Nuclear factor NF-kappa-B complex (2307 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.45Molecular Weight (Monoisotopic): 408.1573AlogP: 4.49#Rotatable Bonds: 6
Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.03CX Basic pKa: CX LogP: 5.05CX LogD: 5.04
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.33Np Likeness Score: 1.24

References

1. Ajiaikebaier D, Li Z, Lin T, Sun X, Wang B, Li J..  (2021)  Synthesis of pyranochalcone derivatives and their inhibitory effect on NF-κB activation.,  42  [PMID:33862226] [10.1016/j.bmcl.2021.128042]

Source