The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-4-(3-(5-hydroxy-7-methoxy-2,2-dimethylchroman-6-yl)-3-oxoprop-1-enyl)phenyl 2-fluorobenzoate ID: ALA4858244
PubChem CID: 164609886
Max Phase: Preclinical
Molecular Formula: C28H25FO6
Molecular Weight: 476.50
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(c(O)c1C(=O)/C=C/c1ccc(OC(=O)c3ccccc3F)cc1)CCC(C)(C)O2
Standard InChI: InChI=1S/C28H25FO6/c1-28(2)15-14-20-23(35-28)16-24(33-3)25(26(20)31)22(30)13-10-17-8-11-18(12-9-17)34-27(32)19-6-4-5-7-21(19)29/h4-13,16,31H,14-15H2,1-3H3/b13-10+
Standard InChI Key: UDXNZTOJHIBTKQ-JLHYYAGUSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
15.7454 -25.7044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5378 -25.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9593 -24.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5378 -26.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2431 -26.7156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2431 -25.0812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.9484 -25.4939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9468 -26.3093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6510 -26.7166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3573 -26.3096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3549 -25.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6501 -25.0875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0654 -26.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0662 -27.5347 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7727 -26.3082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4808 -26.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1881 -26.3068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8923 -26.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5991 -26.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5987 -25.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.8857 -25.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1818 -25.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0613 -25.0802 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.0587 -24.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6503 -27.5338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.3055 -25.0788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0142 -25.4857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7209 -25.0755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0161 -26.3029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.4269 -25.4841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1332 -25.0745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1317 -24.2565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4181 -23.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7147 -24.2616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4272 -26.3013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
2 4 1 0
2 6 1 0
4 5 1 0
5 8 1 0
7 6 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
11 23 1 0
23 24 1 0
9 25 1 0
20 26 1 0
26 27 1 0
27 28 1 0
27 29 2 0
28 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 28 1 0
30 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.50Molecular Weight (Monoisotopic): 476.1635AlogP: 5.76#Rotatable Bonds: 6Polar Surface Area: 82.06Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.48CX Basic pKa: ┄CX LogP: 6.91CX LogD: 6.65Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: 0.38
References 1. Ajiaikebaier D, Li Z, Lin T, Sun X, Wang B, Li J.. (2021) Synthesis of pyranochalcone derivatives and their inhibitory effect on NF-κB activation., 42 [PMID:33862226 ] [10.1016/j.bmcl.2021.128042 ]