The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,6-bis(4-isopropoxyphenyl)-7-methylimidazo[1,2-a]pyridine ID: ALA4858248
PubChem CID: 134179283
Max Phase: Preclinical
Molecular Formula: C26H28N2O2
Molecular Weight: 400.52
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc2ncc(-c3ccc(OC(C)C)cc3)n2cc1-c1ccc(OC(C)C)cc1
Standard InChI: InChI=1S/C26H28N2O2/c1-17(2)29-22-10-6-20(7-11-22)24-16-28-25(15-27-26(28)14-19(24)5)21-8-12-23(13-9-21)30-18(3)4/h6-18H,1-5H3
Standard InChI Key: MJQQLLCMNOALHJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
37.1397 -11.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1458 -6.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.1458 -7.7427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8511 -8.1471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.8511 -6.5128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5563 -6.9255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.5563 -7.7437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.3345 -7.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8155 -7.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.3345 -6.6728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
35.5869 -8.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4387 -8.1523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7290 -7.7471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0223 -8.1560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.0231 -8.9741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.7364 -9.3815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4401 -8.9702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.3186 -9.3812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.6107 -8.9729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9032 -9.3818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6104 -8.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.0382 -9.3761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.2901 -10.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.0901 -10.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6379 -9.7112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3831 -8.9370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.3409 -11.1031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3898 -12.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.6883 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.4369 -6.5190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
2 5 2 0
3 4 2 0
4 7 1 0
6 5 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 6 2 0
8 11 1 0
3 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 12 1 0
15 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
11 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 11 1 0
24 27 1 0
27 1 1 0
1 28 1 0
1 29 1 0
2 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 400.52Molecular Weight (Monoisotopic): 400.2151AlogP: 6.55#Rotatable Bonds: 6Polar Surface Area: 35.76Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.06CX LogP: 5.72CX LogD: 5.70Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.37Np Likeness Score: -0.82
References 1. Plewe MB, Gantla VR, Sokolova NV, Shin YJ, Naik S, Brown ER, Fetsko A, Zhang L, Kalveram B, Freiberg AN, Henkel G, McCormack K.. (2021) Discovery of a novel highly potent broad-spectrum heterocyclic chemical series of arenavirus cell entry inhibitors., 41 [PMID:33965007 ] [10.1016/j.bmcl.2021.127983 ]