The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
tert-Butyl 4-((cyclopropylmethyl)-(6-(5-(methylsulfony1)-2,3-dihydro-1H-indol-1-yl)pyrimidin-4-yl)amino)piperidine-1-carboxylate ID: ALA4858330
PubChem CID: 164612492
Max Phase: Preclinical
Molecular Formula: C27H37N5O4S
Molecular Weight: 527.69
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N1CCC(N(CC2CC2)c2cc(N3CCc4cc(S(C)(=O)=O)ccc43)ncn2)CC1
Standard InChI: InChI=1S/C27H37N5O4S/c1-27(2,3)36-26(33)30-12-10-21(11-13-30)32(17-19-5-6-19)25-16-24(28-18-29-25)31-14-9-20-15-22(37(4,34)35)7-8-23(20)31/h7-8,15-16,18-19,21H,5-6,9-14,17H2,1-4H3
Standard InChI Key: MWJGHTCAUIEAFC-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.1416 -13.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1458 -14.2666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8582 -13.8506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6750 -11.0833 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0917 -11.8000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5040 -11.0808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8069 -12.2125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8058 -13.0398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2342 -12.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5187 -11.7997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2370 -13.0393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5195 -13.4514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6896 -14.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5124 -14.3495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8505 -13.5945 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6579 -13.4247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2049 -14.0386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0116 -13.8694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2690 -13.0846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.7135 -12.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9089 -12.6412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5619 -14.4840 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3693 -14.3147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9181 -14.9349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7224 -14.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9837 -13.9854 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4342 -13.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6234 -13.5350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7917 -13.8191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3397 -14.4358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0518 -13.0362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3779 -12.2128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6959 -14.8863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3048 -15.2679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4974 -15.4372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7137 -15.1847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8830 -15.9921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 2 0
6 5 2 0
7 8 2 0
8 12 1 0
11 9 1 0
9 10 2 0
10 7 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
22 23 1 0
23 24 1 0
23 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
26 29 1 0
29 30 1 0
29 31 2 0
7 5 1 0
5 32 1 0
30 2 1 0
2 33 1 0
22 34 1 0
34 35 1 0
36 35 1 0
37 36 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.69Molecular Weight (Monoisotopic): 527.2566AlogP: 4.19#Rotatable Bonds: 6Polar Surface Area: 95.94Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.79CX LogP: 3.60CX LogD: 3.59Aromatic Rings: 2Heavy Atoms: 37QED Weighted: 0.55Np Likeness Score: -1.54
References 1. Kubo O, Takami K, Kamaura M, Watanabe K, Miyashita H, Abe S, Matsuda K, Tsujihata Y, Odani T, Iwasaki S, Kitazaki T, Murata T, Sato K.. (2021) Discovery of a novel series of GPR119 agonists: Design, synthesis, and biological evaluation of N-(Piperidin-4-yl)-N-(trifluoromethyl)pyrimidin-4-amine derivatives., 41 [PMID:34010766 ] [10.1016/j.bmc.2021.116208 ]