The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-ethyl-2-((R)-1-((S)-3-methylpiperazin-1-yl)butyl)pyrido[4,3-d]pyrimidin-4(3H)-one ID: ALA4858331
PubChem CID: 149136599
Max Phase: Preclinical
Molecular Formula: C18H27N5O
Molecular Weight: 329.45
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CCC[C@H](c1nc2ccncc2c(=O)n1CC)N1CCN[C@@H](C)C1
Standard InChI: InChI=1S/C18H27N5O/c1-4-6-16(22-10-9-20-13(3)12-22)17-21-15-7-8-19-11-14(15)18(24)23(17)5-2/h7-8,11,13,16,20H,4-6,9-10,12H2,1-3H3/t13-,16+/m0/s1
Standard InChI Key: RFQYUCNHWNYTNR-XJKSGUPXSA-N
Molfile:
RDKit 2D
24 26 0 0 0 0 0 0 0 0999 V2000
24.0108 -17.9906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0097 -18.8101 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7177 -19.2191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7159 -17.5817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4245 -17.9870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.4233 -18.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1334 -19.2235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8493 -18.8142 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8505 -17.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.1358 -17.5731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.1311 -20.0407 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.5592 -17.5821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2659 -17.9925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9746 -17.5856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5558 -19.2248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2647 -18.8182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5612 -16.7650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
28.2775 -16.3606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.2814 -15.5470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5765 -15.1329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.8660 -15.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.8604 -16.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.9916 -15.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6813 -17.9959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
7 11 2 0
9 12 1 0
12 13 1 0
13 14 1 0
8 15 1 0
15 16 1 0
12 17 1 6
17 18 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
19 23 1 1
14 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 329.45Molecular Weight (Monoisotopic): 329.2216AlogP: 1.95#Rotatable Bonds: 5Polar Surface Area: 63.05Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.30CX LogP: 1.44CX LogD: -0.45Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.91Np Likeness Score: -0.81
References 1. Fernández A, Díaz JL, García M, Rodríguez-Escrich S, Lorente A, Enrech R, Dordal A, Portillo-Salido E, Porras M, Fernández B, Reinoso RF, Vela JM, Almansa C.. (2021) Piperazinyl Bicyclic Derivatives as Selective Ligands of the α2δ-1 Subunit of Voltage-Gated Calcium Channels., 12 (11.0): [PMID:34795870 ] [10.1021/acsmedchemlett.1c00416 ]