4-(2-(5-(4-(1-(6,7,10-trioxaspiro[4.5]decan-8-yl)vinyl)phenoxy)naphthalen-1-yloxy)ethoxy)-4-oxobutanoic acid

ID: ALA4858334

PubChem CID: 44233046

Max Phase: Preclinical

Molecular Formula: C31H32O9

Molecular Weight: 548.59

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2cccc3c(OCCOC(=O)CCC(=O)O)cccc23)cc1)C1COC2(CCCC2)OO1

Standard InChI:  InChI=1S/C31H32O9/c1-21(28-20-37-31(40-39-28)16-2-3-17-31)22-10-12-23(13-11-22)38-27-9-5-6-24-25(27)7-4-8-26(24)35-18-19-36-30(34)15-14-29(32)33/h4-13,28H,1-3,14-20H2,(H,32,33)

Standard InChI Key:  XHNDWMWIERYJOL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
   28.4399  -18.7441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2365  -18.9567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6849  -18.2649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.1655  -17.6246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3960  -17.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.4365  -18.3609    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.1541  -18.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1545  -19.5948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8712  -20.0032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5849  -19.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.5772  -18.7560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.8598  -18.3512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3031  -19.9935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.3092  -20.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0151  -19.5754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.7298  -19.9856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4398  -19.5708    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.7199  -18.3350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0036  -18.7513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.7239  -18.7782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3018  -19.6089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0244  -20.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7336  -19.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2971  -18.7823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0109  -18.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0086  -17.5457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2934  -17.1352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5788  -17.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.5846  -18.3755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8720  -18.7926    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1543  -18.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4417  -18.8011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7241  -18.3925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.0114  -18.8096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2938  -18.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0163  -19.6354    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2889  -17.5753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0016  -17.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7192  -17.5668    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9966  -16.3323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 15 19  1  0
 16 17  1  0
 17  1  1  0
  1 18  1  0
 18 19  1  0
  6 20  1  0
 20 25  2  0
 24 21  2  0
 21 22  1  0
 22 23  2  0
 23 20  1  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 548.59Molecular Weight (Monoisotopic): 548.2046AlogP: 6.05#Rotatable Bonds: 11
Polar Surface Area: 109.75Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.88CX Basic pKa: CX LogP: 5.70CX LogD: 2.48
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: 0.21

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source