The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(5-(4-(1-(6,7,10-trioxaspiro[4.5]decan-8-yl)vinyl)phenoxy)naphthalen-1-yloxy)ethoxy)-4-oxobutanoic acid ID: ALA4858334
PubChem CID: 44233046
Max Phase: Preclinical
Molecular Formula: C31H32O9
Molecular Weight: 548.59
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=C(c1ccc(Oc2cccc3c(OCCOC(=O)CCC(=O)O)cccc23)cc1)C1COC2(CCCC2)OO1
Standard InChI: InChI=1S/C31H32O9/c1-21(28-20-37-31(40-39-28)16-2-3-17-31)22-10-12-23(13-11-22)38-27-9-5-6-24-25(27)7-4-8-26(24)35-18-19-36-30(34)15-14-29(32)33/h4-13,28H,1-3,14-20H2,(H,32,33)
Standard InChI Key: XHNDWMWIERYJOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
28.4399 -18.7441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.2365 -18.9567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.6849 -18.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
29.1655 -17.6246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3960 -17.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.4365 -18.3609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.1541 -18.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.1545 -19.5948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8712 -20.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5849 -19.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.5772 -18.7560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8598 -18.3512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3031 -19.9935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3092 -20.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.0151 -19.5754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.7298 -19.9856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4398 -19.5708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.7199 -18.3350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
27.0036 -18.7513 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.7239 -18.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3018 -19.6089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0244 -20.0173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7336 -19.5984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2971 -18.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0109 -18.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0086 -17.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2934 -17.1352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5788 -17.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5846 -18.3755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8720 -18.7926 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.1543 -18.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4417 -18.8011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7241 -18.3925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0114 -18.8096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2938 -18.4011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0163 -19.6354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2889 -17.5753 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0016 -17.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7192 -17.5668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9966 -16.3323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
10 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
15 19 1 0
16 17 1 0
17 1 1 0
1 18 1 0
18 19 1 0
6 20 1 0
20 25 2 0
24 21 2 0
21 22 1 0
22 23 2 0
23 20 1 0
24 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
37 38 1 0
38 39 1 0
38 40 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 548.59Molecular Weight (Monoisotopic): 548.2046AlogP: 6.05#Rotatable Bonds: 11Polar Surface Area: 109.75Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.88CX Basic pKa: ┄CX LogP: 5.70CX LogD: 2.48Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.17Np Likeness Score: 0.21
References 1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V.. (2021) Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis., 49 [PMID:34365007 ] [10.1016/j.bmcl.2021.128305 ]