The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,2,2-trifluoro-N-(6-(4-fluoro-2-(piperidin-1-yl)phenyl)pyridazin-3-yl)ethanesulfonamide ID: ALA4858343
PubChem CID: 164613096
Max Phase: Preclinical
Molecular Formula: C17H18F4N4O2S
Molecular Weight: 418.42
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=S(=O)(CC(F)(F)F)Nc1ccc(-c2ccc(F)cc2N2CCCCC2)nn1
Standard InChI: InChI=1S/C17H18F4N4O2S/c18-12-4-5-13(15(10-12)25-8-2-1-3-9-25)14-6-7-16(23-22-14)24-28(26,27)11-17(19,20)21/h4-7,10H,1-3,8-9,11H2,(H,23,24)
Standard InChI Key: RGDQVIHERKSEDA-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
42.7003 -10.7349 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
42.2958 -10.0292 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
41.8869 -10.7323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
37.3541 -11.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.3530 -12.0910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0610 -12.4999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7707 -12.0905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.7679 -11.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
38.0592 -10.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
39.4710 -10.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1805 -11.2655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8862 -10.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8836 -10.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1694 -9.6311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4666 -10.0440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4767 -12.4972 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
39.4761 -13.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1803 -13.7227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8898 -13.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.8905 -12.4984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
40.1817 -12.0864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
41.5892 -9.6247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
43.0046 -9.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.6450 -12.4990 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
43.7134 -10.0241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
43.7156 -10.8413 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.4200 -9.6137 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
44.4172 -10.4295 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
8 10 1 0
16 17 1 0
16 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
7 16 1 0
13 22 1 0
22 2 1 0
2 23 1 0
5 24 1 0
23 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.42Molecular Weight (Monoisotopic): 418.1087AlogP: 3.58#Rotatable Bonds: 5Polar Surface Area: 75.19Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.42CX Basic pKa: 2.70CX LogP: 2.84CX LogD: 2.04Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.75Np Likeness Score: -1.72
References 1. Tsuboi K, Kimura H, Nakatsuji Y, Kassai M, Deai Y, Isobe Y.. (2021) Discovery of N-(6-(5-fluoro-2-(piperidin-1-yl)phenyl)pyridazin-3-yl)-1-(tetrahydro-2H-pyran-4-yl)methanesulfonamide as a brain-permeable and metabolically stable kynurenine monooxygenase inhibitor., 44 [PMID:34015507 ] [10.1016/j.bmcl.2021.128115 ]