1,3-Didecyl-2-methyl-4,9-dioxo-4,9-dihydro-1H-naphtho[2,3-d]imidazol-3-ium bromide

ID: ALA4858428

PubChem CID: 164613105

Max Phase: Preclinical

Molecular Formula: C32H49BrN2O2

Molecular Weight: 493.76

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCn1c2c([n+](CCCCCCCCCC)c1C)C(=O)c1ccccc1C2=O.[Br-]

Standard InChI:  InChI=1S/C32H49N2O2.BrH/c1-4-6-8-10-12-14-16-20-24-33-26(3)34(25-21-17-15-13-11-9-7-5-2)30-29(33)31(35)27-22-18-19-23-28(27)32(30)36;/h18-19,22-23H,4-17,20-21,24-25H2,1-3H3;1H/q+1;/p-1

Standard InChI Key:  HDYHHXRCWANBEX-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 37 38  0  0  0  0  0  0  0  0999 V2000
   24.8776   -5.5178    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   17.0317   -5.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0305   -6.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7453   -6.9234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7435   -5.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4589   -5.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4577   -6.5127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1745   -6.9279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1769   -5.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8985   -5.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.8951   -6.5129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6846   -6.7728    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.1758   -6.1023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6899   -5.4280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1736   -7.7529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1769   -4.4368    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.0008   -6.1055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9364   -7.5584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9480   -4.6444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7427   -7.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.9945   -8.5188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8007   -8.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0526   -9.4792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7556   -4.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0137   -3.6925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8213   -3.5241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0792   -2.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8869   -2.5722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8588   -9.6539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1106  -10.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9169  -10.6143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1687  -11.3999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9750  -11.5747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.1449   -1.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.9525   -1.6202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.2106   -0.8366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0182   -0.6683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  7  2  0
  6  5  2  0
  5  2  1  0
  6  7  1  0
  6  9  1  0
  7  8  1  0
  8 11  1  0
 10  9  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 10  1  0
  8 15  2  0
  9 16  2  0
 13 17  1  0
 12 18  1  0
 14 19  1  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 19 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 23 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 28 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
M  CHG  2   1  -1  14   1
M  END

Associated Targets(non-human)

Mycobacterium tuberculosis variant bovis BCG (1626 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.76Molecular Weight (Monoisotopic): 493.3789AlogP: 8.14#Rotatable Bonds: 18
Polar Surface Area: 42.95Molecular Species: HBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.94CX LogD: 4.94
Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: -0.02

References

1. Fridianto KT, Li M, Hards K, Negatu DA, Cook GM, Dick T, Lam Y, Go ML..  (2021)  Functionalized Dioxonaphthoimidazoliums: A Redox Cycling Chemotype with Potent Bactericidal Activities against Mycobacterium tuberculosis.,  64  (21.0): [PMID:34706190] [10.1021/acs.jmedchem.1c01383]

Source