2-(4-Fluoro-5-methyl-6-oxopyridazin-1(6H)-yl)-N-(4-methyl-3-(N-(2-(pyridin-2-yl)ethyl)sulfamoyl)phenyl)acetamide

ID: ALA4858440

PubChem CID: 162727850

Max Phase: Preclinical

Molecular Formula: C21H22FN5O4S

Molecular Weight: 459.50

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(NC(=O)Cn2ncc(F)c(C)c2=O)cc1S(=O)(=O)NCCc1ccccn1

Standard InChI:  InChI=1S/C21H22FN5O4S/c1-14-6-7-17(26-20(28)13-27-21(29)15(2)18(22)12-24-27)11-19(14)32(30,31)25-10-8-16-5-3-4-9-23-16/h3-7,9,11-12,25H,8,10,13H2,1-2H3,(H,26,28)

Standard InChI Key:  LZWNAMDDHSMCBZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
    1.0855  -20.0583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4982  -19.3526    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.6806  -19.3480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2066  -19.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2055  -20.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9135  -20.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6232  -20.5802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6204  -19.7575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9118  -19.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4986  -18.5355    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3265  -19.3463    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0358  -19.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7420  -19.3409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0389  -20.5694    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4512  -19.7469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4512  -20.5629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1596  -20.9688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8667  -20.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8610  -19.7361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1520  -19.3339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1453  -18.5167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2066  -18.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2071  -17.3101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9150  -16.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6206  -17.3144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3281  -16.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3290  -16.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6165  -15.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9120  -16.0898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4975  -20.9887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5657  -19.3223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5765  -20.9624    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4  2  1  0
  2 10  1  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  1  0
 20 21  2  0
 10 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
  5 30  1  0
 19 31  1  0
 18 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4858440

    ---

Associated Targets(Human)

PRMT5 Tchem PRMT5/MEP50 complex (963 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.50Molecular Weight (Monoisotopic): 459.1377AlogP: 1.55#Rotatable Bonds: 8
Polar Surface Area: 123.05Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.20CX Basic pKa: 4.54CX LogP: 1.35CX LogD: 1.35
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -2.52

References

1. McKinney DC, McMillan BJ, Ranaghan MJ, Moroco JA, Brousseau M, Mullin-Bernstein Z, O'Keefe M, McCarren P, Mesleh MF, Mulvaney KM, Robinson F, Singh R, Bajrami B, Wagner FF, Hilgraf R, Drysdale MJ, Campbell AJ, Skepner A, Timm DE, Porter D, Kaushik VK, Sellers WR, Ianari A..  (2021)  Discovery of a First-in-Class Inhibitor of the PRMT5-Substrate Adaptor Interaction.,  64  (15.0): [PMID:34342224] [10.1021/acs.jmedchem.1c00507]

Source