2,6-difluoro-4-(9-(4-morpholinophenyl)-9H-purin-2-ylamino)phenol

ID: ALA4858455

PubChem CID: 164613626

Max Phase: Preclinical

Molecular Formula: C21H18F2N6O2

Molecular Weight: 424.41

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Oc1c(F)cc(Nc2ncc3ncn(-c4ccc(N5CCOCC5)cc4)c3n2)cc1F

Standard InChI:  InChI=1S/C21H18F2N6O2/c22-16-9-13(10-17(23)19(16)30)26-21-24-11-18-20(27-21)29(12-25-18)15-3-1-14(2-4-15)28-5-7-31-8-6-28/h1-4,9-12,30H,5-8H2,(H,24,26,27)

Standard InChI Key:  AZIATJQXGGRMIL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   28.7135   -3.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7124   -4.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4268   -5.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1429   -4.7370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.1401   -3.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4250   -3.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4226   -2.6734    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   27.9993   -3.4984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.9979   -5.1492    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   30.8576   -5.1482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5711   -4.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2825   -5.1464    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.2749   -3.4972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5649   -3.9123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.9915   -3.9019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9983   -4.7297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7961   -4.9999    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2688   -4.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7767   -3.6397    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.0580   -5.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5100   -6.3976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7715   -7.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5804   -7.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1274   -6.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8630   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.8435   -8.1249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.2970   -8.7379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.5570   -9.5166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3649   -9.6838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.9123   -9.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6519   -8.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  1  8  1  0
  2  9  1  0
  4 10  1  0
 10 11  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 15  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
 26 27  1  0
 26 31  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4858455

    ---

Associated Targets(Human)

RPS6KA3 Tchem Ribosomal protein S6 kinase alpha 3 (4284 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.41Molecular Weight (Monoisotopic): 424.1459AlogP: 3.38#Rotatable Bonds: 4
Polar Surface Area: 88.33Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.28CX Basic pKa: 2.27CX LogP: 3.58CX LogD: 3.52
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.49Np Likeness Score: -1.43

References

1. Casalvieri KA, Matheson CJ, Warfield BM, Backos DS, Reigan P..  (2021)  N-Substituted pyrrolopyrimidines and purines as p90 ribosomal S6 protein kinase-2 (RSK2) inhibitors.,  41  [PMID:34034149] [10.1016/j.bmc.2021.116220]

Source