N-((1S,4S)-4-(2-((2-methoxy-4-(4-methylpiperazin-1-yl)phenyl)amino)-6-methyl-7-oxopyrido[2,3-d]pyrimidin-8(7H)-yl)cydohexyl)cyclohexanecarboxamide

ID: ALA4858486

PubChem CID: 164614226

Max Phase: Preclinical

Molecular Formula: C33H45N7O3

Molecular Weight: 587.77

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N2CCN(C)CC2)ccc1Nc1ncc2cc(C)c(=O)n([C@H]3CC[C@@H](NC(=O)C4CCCCC4)CC3)c2n1

Standard InChI:  InChI=1S/C33H45N7O3/c1-22-19-24-21-34-33(36-28-14-13-27(20-29(28)43-3)39-17-15-38(2)16-18-39)37-30(24)40(32(22)42)26-11-9-25(10-12-26)35-31(41)23-7-5-4-6-8-23/h13-14,19-21,23,25-26H,4-12,15-18H2,1-3H3,(H,35,41)(H,34,36,37)/t25-,26+

Standard InChI Key:  NWQHBBXHIBVFNN-WMPKNSHKSA-N

Molfile:  

 
     RDKit          2D

 43 48  0  0  0  0  0  0  0  0999 V2000
   15.0543  -10.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0575   -9.9372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7661   -9.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4757   -9.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4683  -10.7630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7597  -11.1652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3457  -11.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3384  -11.9738    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6403  -10.7458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6435   -9.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9381   -9.5137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9413   -8.6965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6541   -8.2943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3595   -8.7051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3521   -9.5223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5379   -7.0536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2433   -7.4685    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.9519   -7.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9592   -6.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2497   -5.8342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5411   -6.2364    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6678   -5.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3732   -6.2536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3700   -7.0708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6573   -7.4771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.0713   -7.4857    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0818   -5.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8292   -7.4600    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1238   -7.0491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4111   -7.4514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7057   -7.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7089   -6.2234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4217   -5.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1271   -6.2320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0035   -5.8084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2949   -6.2148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5895   -5.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5968   -4.9827    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3055   -4.5805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0109   -4.9913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8914   -4.5719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4079   -8.2685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6951   -8.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  7  8  2  0
  7  9  1  0
  1  7  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 10 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  2  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 18 25  1  0
 19 22  1  0
 24 26  2  0
 23 27  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  2  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 35 40  1  0
 38 41  1  0
 32 35  1  0
 42 43  1  0
 30 42  1  0
 28 29  1  0
 16 28  1  0
 13 25  1  1
 10  9  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4858486

    ---

Associated Targets(Human)

TTK Tchem Dual specificity protein kinase TTK (2978 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 587.77Molecular Weight (Monoisotopic): 587.3584AlogP: 4.78#Rotatable Bonds: 7
Polar Surface Area: 104.62Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.84CX LogP: 4.68CX LogD: 4.10
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.41Np Likeness Score: -1.32

References

1. Huang M, Huang Y, Guo J, Yu L, Chang Y, Wang X, Luo J, Huang Y, Tu Z, Lu X, Xu Y, Zhang Z, Zhang Z, Ding K..  (2021)  Pyrido[2, 3-d]pyrimidin-7(8H)-ones as new selective orally bioavailable Threonine Tyrosine Kinase (TTK) inhibitors.,  211  [PMID:33248853] [10.1016/j.ejmech.2020.113023]

Source