The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-phenyl 1-fluoro-3-((S)-2-(4-methylpiperazine-1-carboxamido)-3-phenylpropanamido)-5-phenylpent-1-ene-1-sulfonate ID: ALA4858582
PubChem CID: 164610966
Max Phase: Preclinical
Molecular Formula: C32H37FN4O5S
Molecular Weight: 608.74
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN(C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H](/C=C(\F)S(=O)(=O)Oc2ccccc2)CCc2ccccc2)CC1
Standard InChI: InChI=1S/C32H37FN4O5S/c1-36-19-21-37(22-20-36)32(39)35-29(23-26-13-7-3-8-14-26)31(38)34-27(18-17-25-11-5-2-6-12-25)24-30(33)43(40,41)42-28-15-9-4-10-16-28/h2-16,24,27,29H,17-23H2,1H3,(H,34,38)(H,35,39)/b30-24+/t27-,29-/m0/s1
Standard InChI Key: YAPQDMXJCANAIK-OXGCXKMZSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
34.1074 -24.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
33.6988 -24.1402 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
33.2899 -24.8474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
28.0115 -24.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7233 -23.7316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
29.4352 -24.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.0115 -24.9656 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
29.4352 -24.9656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1470 -23.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8588 -24.1443 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5666 -23.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1470 -22.9102 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
30.1470 -25.3783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1425 -26.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8535 -26.6092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5622 -26.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5596 -25.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8521 -24.9661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2784 -24.1443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9902 -23.7316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.4139 -23.7316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
31.5666 -22.9102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8588 -22.5017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8588 -21.6803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5686 -21.2691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5690 -20.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8607 -20.0391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1466 -20.4521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.1497 -21.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1231 -24.1488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1148 -24.9708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8232 -25.3879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5386 -24.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5411 -24.1541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8321 -23.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9892 -22.9102 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
27.3034 -23.7363 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.3066 -22.9189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6026 -22.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8928 -22.9168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
25.8916 -23.7350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.6002 -24.1473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1863 -22.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 1 0
4 7 2 0
6 8 1 6
6 9 1 0
9 10 1 0
10 11 1 0
9 12 2 0
8 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
11 19 1 0
19 20 2 0
20 2 1 0
2 21 1 0
11 22 1 1
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
21 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
20 36 1 0
4 37 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
40 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 608.74Molecular Weight (Monoisotopic): 608.2469AlogP: 3.89#Rotatable Bonds: 12Polar Surface Area: 108.05Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.81CX Basic pKa: 7.02CX LogP: 5.18CX LogD: 5.03Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.30Np Likeness Score: -0.44
References 1. Jung S, Fuchs N, Johe P, Wagner A, Diehl E, Yuliani T, Zimmer C, Barthels F, Zimmermann RA, Klein P, Waigel W, Meyr J, Opatz T, Tenzer S, Distler U, Räder HJ, Kersten C, Engels B, Hellmich UA, Klein J, Schirmeister T.. (2021) Fluorovinylsulfones and -Sulfonates as Potent Covalent Reversible Inhibitors of the Trypanosomal Cysteine Protease Rhodesain: Structure-Activity Relationship, Inhibition Mechanism, Metabolism, and In Vivo Studies., 64 (16.0): [PMID:34378914 ] [10.1021/acs.jmedchem.1c01002 ]