The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(tert-butyl)-5-chlorothiazol-2-yl)-2-isopropyl-6-((1,2,3,4-tetrahydroisoquinolin-7-yl)amino)-1H-pyrazolo[3,4-d]pyrimidin-3(2H)-one ID: ALA4858594
PubChem CID: 155203153
Max Phase: Preclinical
Molecular Formula: C24H28ClN7OS
Molecular Weight: 498.06
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)n1c(=O)c2cnc(Nc3ccc4c(c3)CNCC4)nc2n1-c1nc(C(C)(C)C)c(Cl)s1
Standard InChI: InChI=1S/C24H28ClN7OS/c1-13(2)31-21(33)17-12-27-22(28-16-7-6-14-8-9-26-11-15(14)10-16)30-20(17)32(31)23-29-18(19(25)34-23)24(3,4)5/h6-7,10,12-13,26H,8-9,11H2,1-5H3,(H,27,28,30)
Standard InChI Key: AVFORASMUUZGJJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
8.3535 -7.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -7.5410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6054 -7.1338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3137 -7.5404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3137 -8.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6080 -8.7664 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8974 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1893 -8.7728 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4813 -8.3651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7730 -8.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -8.3657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0644 -7.5459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7704 -7.1351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4813 -7.5407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6476 -7.5458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6476 -8.3656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3560 -8.7735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0897 -8.6013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.5771 -7.9434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.1116 -7.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3237 -6.5010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3942 -7.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8086 -7.2459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7970 -8.6612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3454 -9.3774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.8662 -10.0393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3476 -10.6997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1244 -10.4459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1229 -9.6287 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
15.7864 -10.9250 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.3421 -11.5150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6317 -11.9188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0471 -11.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3380 -12.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
7 6 2 0
2 7 1 0
7 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
12 1 1 0
1 15 1 0
15 16 1 0
16 17 1 0
11 17 1 0
5 18 1 0
18 19 1 0
20 19 1 0
4 20 1 0
20 21 2 0
19 22 1 0
22 23 1 0
22 24 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 25 1 0
18 25 1 0
28 30 1 0
27 31 1 0
31 32 1 0
31 33 1 0
31 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.06Molecular Weight (Monoisotopic): 497.1765AlogP: 4.96#Rotatable Bonds: 4Polar Surface Area: 89.66Molecular Species: BASEHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.83CX Basic pKa: 9.03CX LogP: 4.92CX LogD: 3.28Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.09
References 1. (2020) Heterocyclic compounds and uses thereof,