1-(1-(3-(3,5-Bis(trifluoromethyl)phenoxy)benzyl)piperidin-4-yl)-5-methylpyrimidine-2,4(1H,3H)-dione

ID: ALA4858644

PubChem CID: 164613640

Max Phase: Preclinical

Molecular Formula: C25H23F6N3O3

Molecular Weight: 527.47

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cn(C2CCN(Cc3cccc(Oc4cc(C(F)(F)F)cc(C(F)(F)F)c4)c3)CC2)c(=O)[nH]c1=O

Standard InChI:  InChI=1S/C25H23F6N3O3/c1-15-13-34(23(36)32-22(15)35)19-5-7-33(8-6-19)14-16-3-2-4-20(9-16)37-21-11-17(24(26,27)28)10-18(12-21)25(29,30)31/h2-4,9-13,19H,5-8,14H2,1H3,(H,32,35,36)

Standard InChI Key:  BLDIUVTWIXKUGA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   12.7449  -19.4351    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.3404  -18.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9314  -19.4325    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.9347  -16.2737    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.7519  -16.2737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3433  -15.5660    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.0530  -17.5035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0519  -18.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7599  -18.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4696  -18.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4667  -17.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7581  -17.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1779  -18.7301    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8850  -18.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5936  -18.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3002  -18.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2993  -17.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5860  -17.0960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8823  -17.5073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0083  -18.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7156  -18.3198    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.4230  -18.7329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1282  -18.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.1315  -17.5095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4235  -17.0995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7122  -17.5070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8403  -17.1028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.5461  -17.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2528  -17.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2592  -16.2968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5528  -15.8841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8399  -16.2890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9578  -17.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9695  -15.8928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1335  -15.8780    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4622  -15.8668    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.6364  -18.3220    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  5  4  1  0
  6  5  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
 10 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 16 20  1  0
 20 21  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 27 32  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 29 33  1  0
 30 34  2  0
 32 35  2  0
 12  5  1  0
  5 36  1  0
  8  2  1  0
  2 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4858644

    ---

Associated Targets(Human)

MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

tmk Thymidylate kinase (360 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 527.47Molecular Weight (Monoisotopic): 527.1644AlogP: 5.51#Rotatable Bonds: 5
Polar Surface Area: 67.33Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.32CX Basic pKa: 8.01CX LogP: 4.77CX LogD: 4.06
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.44Np Likeness Score: -0.96

References

1. Song L, Merceron R, Hulpia F, Lucía A, Gracia B, Jian Y, Risseeuw MDP, Verstraelen T, Cos P, Aínsa JA, Boshoff HI, Munier-Lehmann H, Savvides SN, Van Calenbergh S..  (2021)  Structure-aided optimization of non-nucleoside M. tuberculosis thymidylate kinase inhibitors.,  225  [PMID:34450493] [10.1016/j.ejmech.2021.113784]

Source