N-(3-methoxybenzyl)-6-(quinolin-6-yl)imidazo[1,2-a]pyridine-3-carboxamide

ID: ALA4858661

PubChem CID: 164614227

Max Phase: Preclinical

Molecular Formula: C25H20N4O2

Molecular Weight: 408.46

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cccc(CNC(=O)c2cnc3ccc(-c4ccc5ncccc5c4)cn23)c1

Standard InChI:  InChI=1S/C25H20N4O2/c1-31-21-6-2-4-17(12-21)14-28-25(30)23-15-27-24-10-8-20(16-29(23)24)18-7-9-22-19(13-18)5-3-11-26-22/h2-13,15-16H,14H2,1H3,(H,28,30)

Standard InChI Key:  JOLOZYZEROYPOL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   37.8690  -16.3478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.8690  -17.1752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5831  -17.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5831  -15.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2972  -16.3478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.2972  -17.1716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0807  -17.4263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.5651  -16.7598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0808  -16.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1536  -15.9371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3365  -15.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.1459  -15.1344    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.7828  -14.6915    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.4015  -14.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2109  -14.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7627  -14.7925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5714  -14.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.8277  -13.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2693  -13.2171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.4628  -13.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.1537  -15.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7295  -15.9467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4446  -16.3536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7249  -15.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4369  -14.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4363  -13.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7246  -13.4767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0119  -13.8922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.0159  -14.7108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.1247  -15.2362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.8686  -16.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  2  0
  2  3  2  0
  3  6  1  0
  5  4  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  1 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  2  0
 14 12  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 21  2  0
 21 25  1  0
 24 22  1  0
 22 23  2  0
 23 10  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 24  2  0
 17 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4858661

    ---

Associated Targets(Human)

CLK1 Tchem Dual specificty protein kinase CLK1 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.46Molecular Weight (Monoisotopic): 408.1586AlogP: 4.49#Rotatable Bonds: 5
Polar Surface Area: 68.52Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.83CX LogP: 3.13CX LogD: 3.12
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.40

References

1. Zhang Y, Xia A, Zhang S, Lin G, Liu J, Chen P, Mu B, Jiao Y, Xu W, Chen M, Li L..  (2021)  Discovery of 3,6-disubstutited-imidazo[1,2-a]pyridine derivatives as a new class of CLK1 inhibitors.,  41  [PMID:33662541] [10.1016/j.bmcl.2021.127881]

Source