The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-(5-((dimethylamino)methyl)-1-oxoisoindolin-2-yl)-5-(((5-fluoro-2,3-dihydrobenzofuran-4-yl)methyl)amino)pyrido[3,4-d]pyridazin-1(2H)-one ID: ALA4858670
PubChem CID: 164614233
Max Phase: Preclinical
Molecular Formula: C27H25FN6O3
Molecular Weight: 500.53
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)Cc1ccc2c(c1)CN(c1cnc(NCc3c(F)ccc4c3CCO4)c3cn[nH]c(=O)c13)C2=O
Standard InChI: InChI=1S/C27H25FN6O3/c1-33(2)13-15-3-4-17-16(9-15)14-34(27(17)36)22-12-30-25(20-11-31-32-26(35)24(20)22)29-10-19-18-7-8-37-23(18)6-5-21(19)28/h3-6,9,11-12H,7-8,10,13-14H2,1-2H3,(H,29,30)(H,32,35)
Standard InChI Key: DQRVZIFGESNLBU-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 42 0 0 0 0 0 0 0 0999 V2000
24.9621 -16.6985 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.9621 -17.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6767 -17.9364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6767 -16.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6767 -15.4523 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3938 -15.0383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3938 -14.2103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3968 -12.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6772 -12.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.6805 -13.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1143 -12.9722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1128 -13.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8967 -14.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3826 -13.3868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8991 -12.7188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
24.9648 -14.2184 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
25.6765 -18.7633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.3878 -16.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3959 -17.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1099 -17.9260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.8205 -17.5091 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.8125 -16.6848 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
27.0939 -16.2772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1168 -18.7540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.0125 -19.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.3502 -19.2497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.2245 -18.9949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.0947 -20.0360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2697 -20.0329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8563 -20.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2667 -21.4599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0948 -21.4591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5045 -20.7468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.5097 -22.1757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0966 -22.8933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.5116 -23.6099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.2686 -22.8944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 2 0
2 3 2 0
3 19 1 0
18 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 12 2 0
11 8 2 0
8 9 1 0
9 10 2 0
10 7 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 11 1 0
10 16 1 0
3 17 1 0
18 19 2 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
20 24 2 0
17 25 1 0
25 29 1 0
28 26 1 0
26 17 1 0
25 27 2 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
34 35 1 0
35 36 1 0
35 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.53Molecular Weight (Monoisotopic): 500.1972AlogP: 3.23#Rotatable Bonds: 6Polar Surface Area: 103.45Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.28CX Basic pKa: 8.34CX LogP: 1.97CX LogD: 1.20Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.42Np Likeness Score: -1.14
References 1. Bagal SK, Gregson C, O' Donovan DH, Pike KG, Bloecher A, Barton P, Borodovsky A, Code E, Fillery SM, Hsu JH, Kawatkar SP, Li C, Longmire D, Nai Y, Nash SC, Pike A, Robinson J, Read JA, Rawlins PB, Shen M, Tang J, Wang P, Woods H, Williamson B.. (2021) Diverse, Potent, and Efficacious Inhibitors That Target the EED Subunit of the Polycomb Repressive Complex 2 Methyltransferase., 64 (23.0): [PMID:34807608 ] [10.1021/acs.jmedchem.1c01161 ]