(E)-7-((3,5-Dimethoxyphenyl)amino)-5-((3-(4-(dimethylamino)but-2-enamido)benzyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide

ID: ALA4858740

PubChem CID: 164615344

Max Phase: Preclinical

Molecular Formula: C28H32N8O4

Molecular Weight: 544.62

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(Nc2nc(NCc3cccc(NC(=O)/C=C/CN(C)C)c3)n3ccnc3c2C(N)=O)cc(OC)c1

Standard InChI:  InChI=1S/C28H32N8O4/c1-35(2)11-6-9-23(37)32-19-8-5-7-18(13-19)17-31-28-34-26(24(25(29)38)27-30-10-12-36(27)28)33-20-14-21(39-3)16-22(15-20)40-4/h5-10,12-16,33H,11,17H2,1-4H3,(H2,29,38)(H,31,34)(H,32,37)/b9-6+

Standard InChI Key:  YKGCSUVCFWPKEA-RMKNXTFCSA-N

Molfile:  

 
     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
    3.9334  -19.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9334  -20.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6454  -20.4753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3575  -20.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6454  -18.8253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3544  -19.2402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9681  -18.6942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6385  -17.9417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8210  -18.0229    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0721  -20.4792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0725  -21.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7871  -21.7164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2177  -18.8315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153  -18.0065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5044  -19.2462    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2195  -20.4806    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2207  -21.3055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5055  -21.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5064  -22.5411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219  -22.9534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9382  -22.5355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9338  -21.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6547  -22.9443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6589  -23.7694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7923  -22.9543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7930  -23.7794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7851  -22.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4990  -22.9511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2143  -22.5382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2113  -21.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4969  -21.3006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9241  -21.2936    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6402  -21.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3531  -21.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6435  -22.5283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0691  -21.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7820  -21.2824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4981  -21.6921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2110  -21.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5014  -22.5171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  5  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  2  0
  4 10  1  0
 10 11  1  0
 11 12  1  0
  1 13  1  0
 13 14  1  0
 13 15  2  0
  2 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 17  1  0
 21 23  1  0
 23 24  1  0
 19 25  1  0
 25 26  1  0
 12 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 12  1  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  2  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4858740

    ---

Associated Targets(Human)

ZAP70 Tchem Tyrosine-protein kinase ZAP-70 (2189 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SYK Tclin Tyrosine-protein kinase SYK (7372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.2547AlogP: 3.26#Rotatable Bonds: 12
Polar Surface Area: 148.14Molecular Species: BASEHBA: 10HBD: 4
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.70CX Basic pKa: 8.81CX LogP: 3.12CX LogD: 1.70
Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -1.10

References

1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S..  (2021)  Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor.,  219  [PMID:33845236] [10.1016/j.ejmech.2021.113393]

Source