The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-7-((3,5-Dimethoxyphenyl)amino)-5-((3-(4-(dimethylamino)but-2-enamido)benzyl)amino)imidazo[1,2-c]pyrimidine-8-carboxamide ID: ALA4858740
PubChem CID: 164615344
Max Phase: Preclinical
Molecular Formula: C28H32N8O4
Molecular Weight: 544.62
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Nc2nc(NCc3cccc(NC(=O)/C=C/CN(C)C)c3)n3ccnc3c2C(N)=O)cc(OC)c1
Standard InChI: InChI=1S/C28H32N8O4/c1-35(2)11-6-9-23(37)32-19-8-5-7-18(13-19)17-31-28-34-26(24(25(29)38)27-30-10-12-36(27)28)33-20-14-21(39-3)16-22(15-20)40-4/h5-10,12-16,33H,11,17H2,1-4H3,(H2,29,38)(H,31,34)(H,32,37)/b9-6+
Standard InChI Key: YKGCSUVCFWPKEA-RMKNXTFCSA-N
Molfile:
RDKit 2D
40 43 0 0 0 0 0 0 0 0999 V2000
3.9334 -19.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9334 -20.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6454 -20.4753 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3575 -20.0670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6454 -18.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3544 -19.2402 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9681 -18.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6385 -17.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8210 -18.0229 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0721 -20.4792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0725 -21.3042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7871 -21.7164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2177 -18.8315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2153 -18.0065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5044 -19.2462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2195 -20.4806 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2207 -21.3055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5055 -21.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5064 -22.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 -22.9534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9382 -22.5355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9338 -21.7126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6547 -22.9443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6589 -23.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7923 -22.9543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7930 -23.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7851 -22.5390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4990 -22.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2143 -22.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2113 -21.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4969 -21.3006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9241 -21.2936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6402 -21.7033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3531 -21.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6435 -22.5283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0691 -21.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7820 -21.2824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4981 -21.6921 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2110 -21.2767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5014 -22.5171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 5 1 0
2 3 1 0
3 4 2 0
4 6 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 5 2 0
4 10 1 0
10 11 1 0
11 12 1 0
1 13 1 0
13 14 1 0
13 15 2 0
2 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
21 23 1 0
23 24 1 0
19 25 1 0
25 26 1 0
12 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 12 1 0
30 32 1 0
32 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
36 37 1 0
37 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 544.62Molecular Weight (Monoisotopic): 544.2547AlogP: 3.26#Rotatable Bonds: 12Polar Surface Area: 148.14Molecular Species: BASEHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.70CX Basic pKa: 8.81CX LogP: 3.12CX LogD: 1.70Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.20Np Likeness Score: -1.10
References 1. Rao D, Li H, Ren X, Sun Y, Wen C, Zheng M, Huang H, Tang W, Xu S.. (2021) Discovery of a potent, selective, and covalent ZAP-70 kinase inhibitor., 219 [PMID:33845236 ] [10.1016/j.ejmech.2021.113393 ]