The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ent-4-amino-16-oxo-19-norbeyeran-15-beta-methyl-2,3,4-trimethoxybenzoate ID: ALA4858776
PubChem CID: 164614832
Max Phase: Preclinical
Molecular Formula: C30H43NO6
Molecular Weight: 513.68
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(=O)OC[C@@H]2C(=O)[C@@]3(C)CC[C@H]4[C@]5(C)CCC[C@@](C)(N)[C@H]5CC[C@@]24C3)c(OC)c1OC
Standard InChI: InChI=1S/C30H43NO6/c1-27-14-10-22-28(2)12-7-13-29(3,31)21(28)11-15-30(22,17-27)19(25(27)32)16-37-26(33)18-8-9-20(34-4)24(36-6)23(18)35-5/h8-9,19,21-22H,7,10-17,31H2,1-6H3/t19-,21+,22+,27+,28-,29-,30-/m1/s1
Standard InChI Key: MDLVWGGEZQTBED-NREKJJSKSA-N
Molfile:
RDKit 2D
39 43 0 0 0 0 0 0 0 0999 V2000
1.2601 -3.6050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8481 -4.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6745 -4.3191 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5490 -2.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5490 -3.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2601 -1.9563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9711 -2.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9700 -3.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6760 -3.6083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3945 -3.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6826 -1.9596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3957 -2.3845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1129 -1.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1267 -1.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4136 -0.7276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6909 -1.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2551 -2.7850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6758 -2.7850 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8453 -0.7489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9640 -1.5454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1059 -2.7937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8371 -1.5604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6346 -1.3515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4927 -3.5186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3357 -3.5470 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7328 -4.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5758 -4.3193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2868 -5.0071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9667 -5.0636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8090 -5.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2558 -4.3757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8543 -3.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0133 -3.6041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6155 -2.8621 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3016 -2.9113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.0601 -2.1452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1445 -2.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1007 -4.4065 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.4955 -5.1520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 1
1 3 1 0
4 5 1 0
4 6 1 0
5 1 1 0
1 8 1 0
7 6 1 0
7 8 1 0
7 11 1 0
8 9 1 0
9 10 1 0
10 12 1 0
11 12 1 0
11 16 1 0
12 13 1 1
13 14 1 0
14 15 1 0
15 16 1 0
8 17 1 1
11 18 1 1
14 19 1 1
7 20 1 6
12 21 1 0
14 22 1 0
21 22 1 0
22 23 2 0
21 24 1 1
24 25 1 0
25 26 1 0
26 27 1 0
26 28 2 0
27 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 27 1 0
33 34 1 0
32 35 1 0
34 36 1 0
35 37 1 0
31 38 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 513.68Molecular Weight (Monoisotopic): 513.3090AlogP: 5.18#Rotatable Bonds: 6Polar Surface Area: 97.08Molecular Species: BASEHBA: 7HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 10.52CX LogP: 4.87CX LogD: 2.10Aromatic Rings: 1Heavy Atoms: 37QED Weighted: 0.52Np Likeness Score: 1.37
References 1. Zhang H, Liu B, Xu G, Xu C, Ou E, Liu J, Sun X, Zhao Y.. (2021) Synthesis and in vivo screening of isosteviol derivatives as new cardioprotective agents., 219 [PMID:33862515 ] [10.1016/j.ejmech.2021.113396 ]