Podospin F

ID: ALA4858781

PubChem CID: 38360240

Max Phase: Preclinical

Molecular Formula: C19H24O6

Molecular Weight: 348.40

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)/C=C/CC[C@H](O)C(=O)CCC[C@H](C)OC2=O

Standard InChI:  InChI=1S/C19H24O6/c1-12-6-5-9-16(21)15(20)8-4-3-7-13-10-14(24-2)11-17(22)18(13)19(23)25-12/h3,7,10-12,15,20,22H,4-6,8-9H2,1-2H3/b7-3+/t12-,15-/m0/s1

Standard InChI Key:  CMVZTZGEDJDOTE-RRNHBABESA-N

Molfile:  

 
     RDKit          2D

 25 26  0  0  0  0  0  0  0  0999 V2000
   16.2434  -10.7101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2422  -11.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9503  -11.9386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9485  -10.3013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6571  -10.7065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6559  -11.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3621  -11.9362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3644  -10.2949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0752  -10.7085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.0717  -11.5272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4898  -10.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7819  -10.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4864  -11.5331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7754  -11.9351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7681  -12.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4700  -13.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1810  -12.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1900  -11.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9460   -9.4841    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5342  -11.9377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8268  -11.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4616  -13.9807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.3645   -9.4777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7842   -9.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8846  -13.1772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  5  8  1  0
  6  7  1  0
  7 10  2  0
  9  8  1  0
  9 12  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
  4 19  1  0
  2 20  1  0
 20 21  1  0
 16 22  1  1
  8 23  2  0
 12 24  1  1
 17 25  2  0
M  END

Associated Targets(non-human)

Splenocyte (1641 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.40Molecular Weight (Monoisotopic): 348.1573AlogP: 2.85#Rotatable Bonds: 1
Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.59CX Basic pKa: CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.76Np Likeness Score: 1.66

References

1. Gao Y, Duan FF, Liu L, Peng XG, Meng XG, Ruan HL..  (2021)  Hypothemycin-Type Resorcylic Acid Lactones with Immunosuppressive Activities from a Podospora sp.,  84  (2.0): [PMID:33544615] [10.1021/acs.jnatprod.0c01344]

Source