2-(6-(1H-indol-3-yl)-1H-benzo[d][1,2,3]triazol-1-yl)-N,N-dimethylethan-1-amine

ID: ALA4858952

PubChem CID: 164616395

Max Phase: Preclinical

Molecular Formula: C18H19N5

Molecular Weight: 305.39

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCn1nnc2cc(-c3c[nH]c4ccccc34)ccc21

Standard InChI:  InChI=1S/C18H19N5/c1-22(2)9-10-23-18-8-7-13(11-17(18)20-21-23)15-12-19-16-6-4-3-5-14(15)16/h3-8,11-12,19H,9-10H2,1-2H3

Standard InChI Key:  WWVZYCWRMRETKI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   38.1218   -4.9320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1206   -5.7515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8287   -6.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.8269   -4.5231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5355   -4.9284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.5403   -5.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3204   -5.9955    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.7977   -5.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3126   -4.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5606   -3.8923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.3607   -3.7225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2562   -2.5177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.0119   -3.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0607   -2.3366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6058   -2.9423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.3504   -2.6110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.2654   -1.8005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.4683   -1.6310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.1361   -0.8844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.6165   -0.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2843    0.5233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.7626    1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.4713    0.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  9 10  1  0
 10 11  2  0
 11 15  1  0
 14 12  1  0
 12 13  2  0
 13 10  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4858952

    ---

Associated Targets(Human)

TDO2 Tchem Tryptophan 2,3-dioxygenase (1554 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 305.39Molecular Weight (Monoisotopic): 305.1640AlogP: 3.14#Rotatable Bonds: 4
Polar Surface Area: 49.74Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.88CX LogP: 3.19CX LogD: 1.70
Aromatic Rings: 4Heavy Atoms: 23QED Weighted: 0.63Np Likeness Score: -1.47

References

1. Kozlova A, Thabault L, Liberelle M, Klaessens S, Prévost JRC, Mathieu C, Pilotte L, Stroobant V, Van den Eynde B, Frédérick R..  (2021)  Rational Design of Original Fused-Cycle Selective Inhibitors of Tryptophan 2,3-Dioxygenase.,  64  (15.0): [PMID:34338527] [10.1021/acs.jmedchem.1c00323]

Source