The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-N-[4-(1-isopropyl-7,8-dimethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yloxy)-phenyl]-2-methoxybenzenesulfonamide ID: ALA4859014
PubChem CID: 164616977
Max Phase: Preclinical
Molecular Formula: C27H26ClN5O4S
Molecular Weight: 552.06
Molecule Type: Unknown
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cl)cc1S(=O)(=O)Nc1ccc(Oc2nc3cc(C)c(C)cc3n3c(C(C)C)nnc23)cc1
Standard InChI: InChI=1S/C27H26ClN5O4S/c1-15(2)25-30-31-26-27(29-21-12-16(3)17(4)13-22(21)33(25)26)37-20-9-7-19(8-10-20)32-38(34,35)24-14-18(28)6-11-23(24)36-5/h6-15,32H,1-5H3
Standard InChI Key: HDROFWOYVKTLMO-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
10.4006 -14.4948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8133 -15.2047 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.2218 -14.4923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.5368 -15.5933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2319 -15.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9523 -15.5518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9720 -16.3684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2770 -16.7982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5600 -16.4078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1145 -15.6132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2065 -14.3455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.9037 -13.9193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4026 -15.2094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6963 -15.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9886 -15.2150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9829 -14.3979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6892 -13.9844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4011 -14.3923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2752 -13.9941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8683 -15.6341 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5745 -15.2206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5689 -14.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8570 -13.9997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1549 -14.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4430 -14.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7367 -14.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7423 -15.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4501 -15.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1564 -15.2262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8513 -16.5138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.1847 -15.7643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0404 -16.4313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0361 -15.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0290 -14.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3002 -17.6127 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.4955 -17.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6956 -16.8730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7505 -17.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
8 9 1 0
4 9 2 0
2 10 1 0
4 2 1 0
11 12 1 0
5 11 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
20 29 1 0
24 29 2 0
30 31 1 0
30 32 2 0
20 32 1 0
21 31 2 0
19 22 1 0
27 33 1 0
26 34 1 0
16 19 1 0
10 13 1 0
8 35 1 0
32 36 1 0
36 37 1 0
36 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 552.06Molecular Weight (Monoisotopic): 551.1394AlogP: 6.27#Rotatable Bonds: 7Polar Surface Area: 107.71Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.04CX Basic pKa: 1.85CX LogP: 5.41CX LogD: 4.99Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.70
References 1. Lee S, Lee S, Cil O, Diez-Cecilia E, Anderson MO, Verkman AS.. (2018) Nanomolar-Potency 1,2,4-Triazoloquinoxaline Inhibitors of the Kidney Urea Transporter UT-A1., 61 (7.0): [PMID:29589443 ] [10.1021/acs.jmedchem.8b00343 ]