The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(3-Fluoro-2-hydroxyphenyl)-6-methyl-5-(5-methyl-2-thienyl)-3-(2-phenylethyl)-4(3H)-pyrimidinone ID: ALA4859029
PubChem CID: 135513459
Max Phase: Preclinical
Molecular Formula: C24H21FN2O2S
Molecular Weight: 420.51
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-c2c(C)nc(-c3cccc(F)c3O)n(CCc3ccccc3)c2=O)s1
Standard InChI: InChI=1S/C24H21FN2O2S/c1-15-11-12-20(30-15)21-16(2)26-23(18-9-6-10-19(25)22(18)28)27(24(21)29)14-13-17-7-4-3-5-8-17/h3-12,28H,13-14H2,1-2H3
Standard InChI Key: FOSZTBOMAKNEAC-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
4.1506 -3.3678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1494 -4.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8575 -4.5963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5671 -4.1868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5643 -3.3642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8557 -2.9589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2720 -4.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2719 -5.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9794 -5.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6875 -5.4095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6836 -4.5881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9755 -4.1844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4414 -4.5954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8532 -2.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4427 -2.9601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3571 -2.1474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5577 -1.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1493 -2.6856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6963 -3.2926 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3366 -2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2705 -2.9529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9797 -3.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6859 -2.9476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3935 -3.3569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0992 -2.9463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0966 -2.1283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3824 -1.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6796 -2.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5644 -5.8208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9803 -6.6365 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 1 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 7 1 0
2 13 1 0
6 14 2 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 15 1 0
1 15 1 0
18 20 1 0
5 21 1 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
8 29 1 0
9 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.51Molecular Weight (Monoisotopic): 420.1308AlogP: 5.34#Rotatable Bonds: 5Polar Surface Area: 55.12Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.70CX Basic pKa: ┄CX LogP: 5.85CX LogD: 5.68Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -1.04
References 1. Ramanjulu JM, Williams SP, Lakdawala AS, DeMartino MP, Lan Y, Marquis RW.. (2021) Overcoming the Pregnane X Receptor Liability: Rational Design to Eliminate PXR-Mediated CYP Induction., 12 (9.0): [PMID:34531948 ] [10.1021/acsmedchemlett.1c00187 ]