10-(4-ethylphenyl)-7,8-dihydro-5H-indeno[1,2-b]quinoline-9,11(6H,10H)-dione

ID: ALA4859150

PubChem CID: 3156663

Max Phase: Preclinical

Molecular Formula: C24H21NO2

Molecular Weight: 355.44

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1ccc(C2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc23)cc1

Standard InChI:  InChI=1S/C24H21NO2/c1-2-14-10-12-15(13-11-14)20-21-18(8-5-9-19(21)26)25-23-16-6-3-4-7-17(16)24(27)22(20)23/h3-4,6-7,10-13,20,25H,2,5,8-9H2,1H3

Standard InChI Key:  JLVMMVLYPFSJMT-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
   33.5398  -25.9458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5386  -26.7736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2538  -27.1867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9706  -26.7731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9677  -25.9422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2520  -25.5329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2480  -24.7132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2487  -23.0633    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9629  -23.4778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9627  -24.2992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6700  -24.7078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3821  -24.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3823  -23.4781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6704  -23.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5321  -24.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5298  -23.4774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7456  -24.5628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2573  -23.8946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.7440  -23.2274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4095  -22.4744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5884  -22.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.1031  -23.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4404  -23.8098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4926  -25.3485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.6687  -25.5332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2536  -28.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5387  -28.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  7 10  1  0
  7 15  1  0
  9  8  1  0
  8 16  1  0
  6  7  1  0
  9 10  2  0
  9 14  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 15 16  2  0
 16 19  1  0
 18 17  1  0
 17 15  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 17 24  2  0
 11 25  2  0
  3 26  1  0
 26 27  1  0
M  END

Associated Targets(Human)

GPR174 Tchem Probable G-protein coupled receptor 174 (370 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 355.44Molecular Weight (Monoisotopic): 355.1572AlogP: 4.55#Rotatable Bonds: 2
Polar Surface Area: 46.17Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.87CX LogD: 3.87
Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.86Np Likeness Score: -0.59

References

1.  (2020)  Inhibitors of GPR174 and Uses Thereof, 
2.  (2020)  Methods and Compositions for Treating Cancer, 

Source