Methyl-9-(2-(azepan-1-yl)ethyl)-2-methyl-9H-benzo[d]imidazo[1,2-a]imidazole-3-carboxylate

ID: ALA4859152

PubChem CID: 164615425

Max Phase: Preclinical

Molecular Formula: C20H26N4O2

Molecular Weight: 354.45

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)c1c(C)nc2n(CCN3CCCCCC3)c3ccccc3n12

Standard InChI:  InChI=1S/C20H26N4O2/c1-15-18(19(25)26-2)24-17-10-6-5-9-16(17)23(20(24)21-15)14-13-22-11-7-3-4-8-12-22/h5-6,9-10H,3-4,7-8,11-14H2,1-2H3

Standard InChI Key:  MKIIWURMYDBCCP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 29  0  0  0  0  0  0  0  0999 V2000
   13.3184  -10.7729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5298  -10.5240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0487  -11.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5381  -11.8589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3220  -11.5994    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.0981  -10.5135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.5875  -11.1763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1064  -11.8483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2088  -12.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3857  -12.7063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9005  -12.0434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2298  -11.2841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3659  -12.6321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1751  -12.7963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8537  -13.2771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4140  -11.1727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2702   -9.7402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4611   -9.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1997   -8.8018    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.8029   -8.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7107   -7.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0247   -6.9481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2409   -7.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9557   -7.9823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3832   -8.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0372  -13.1523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  5  8  1  0
  1  6  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  3 12  2  0
  4  9  2  0
 13 14  2  0
 13 15  1  0
  8 13  1  0
  7 16  1  0
 17 18  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 19 25  1  0
 18 19  1  0
  2 17  1  0
 15 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4859152

    ---

Associated Targets(Human)

TRPM2 Tchem Transient receptor potential cation channel subfamily M member 2 (348 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 354.45Molecular Weight (Monoisotopic): 354.2056AlogP: 3.26#Rotatable Bonds: 4
Polar Surface Area: 51.77Molecular Species: BASEHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.59CX LogP: 2.66CX LogD: 0.49
Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.68Np Likeness Score: -1.33

References

1. Zhao S, Zhang H, Jin H, Cai X, Zhang R, Jin Z, Yang W, Yu P, Zhang L, Liu Z..  (2021)  Design, synthesis and biological activities of benzo[d]imidazo[1,2-a]imidazole derivatives as TRPM2-specfic inhibitors.,  225  [PMID:34416664] [10.1016/j.ejmech.2021.113750]

Source