The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
9-(3,4-dichlorobenzylamino)-2-(2,4-dimethoxyphenyl)-3-hydroxy-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one ID: ALA4859240
PubChem CID: 164617020
Max Phase: Preclinical
Molecular Formula: C26H22Cl2N2O6
Molecular Weight: 529.38
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2oc3c4c(ccc3c(=O)c2O)OCN(NCc2ccc(Cl)c(Cl)c2)C4)c(OC)c1
Standard InChI: InChI=1S/C26H22Cl2N2O6/c1-33-15-4-5-16(22(10-15)34-2)26-24(32)23(31)17-6-8-21-18(25(17)36-26)12-30(13-35-21)29-11-14-3-7-19(27)20(28)9-14/h3-10,29,32H,11-13H2,1-2H3
Standard InChI Key: OCBUDARWYXQUQC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
32.2553 -6.7855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9701 -7.1984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6837 -5.9546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
33.6825 -6.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3955 -7.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1141 -6.7850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1153 -5.9566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
34.3978 -5.5391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
34.3932 -8.0210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8274 -7.1995 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.8288 -5.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5426 -5.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2576 -5.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.2601 -4.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
36.5416 -4.3148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.8295 -4.7272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
35.1149 -4.3149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
35.1147 -3.4900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
37.9749 -4.3171 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
38.6890 -4.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2558 -5.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9652 -5.5346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.9659 -4.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2589 -4.3088 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5495 -4.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5472 -5.5378 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
32.2607 -3.4838 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
31.5472 -3.0698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5491 -2.2448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2674 -1.8348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
32.2696 -1.0107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5555 -0.5957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8378 -1.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
30.8391 -1.8338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
31.5563 0.2373 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
32.9853 -0.6001 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
21 1 2 0
1 2 1 0
2 4 2 0
3 22 2 0
3 4 1 0
3 8 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
5 9 2 0
6 10 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
7 11 1 0
16 17 1 0
17 18 1 0
14 19 1 0
19 20 1 0
21 22 1 0
21 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
32 35 1 0
31 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.38Molecular Weight (Monoisotopic): 528.0855AlogP: 5.35#Rotatable Bonds: 6Polar Surface Area: 93.40Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.94CX Basic pKa: 5.18CX LogP: 4.23CX LogD: 4.21Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.12
References 1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P.. (2021) Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment., 64 (20.0): [PMID:34644502 ] [10.1021/acs.jmedchem.1c00087 ]