9-(3,4-dichlorobenzylamino)-2-(2,4-dimethoxyphenyl)-3-hydroxy-9,10-dihydrochromeno[8,7-e][1,3]oxazin-4(8H)-one

ID: ALA4859240

PubChem CID: 164617020

Max Phase: Preclinical

Molecular Formula: C26H22Cl2N2O6

Molecular Weight: 529.38

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2oc3c4c(ccc3c(=O)c2O)OCN(NCc2ccc(Cl)c(Cl)c2)C4)c(OC)c1

Standard InChI:  InChI=1S/C26H22Cl2N2O6/c1-33-15-4-5-16(22(10-15)34-2)26-24(32)23(31)17-6-8-21-18(25(17)36-26)12-30(13-35-21)29-11-14-3-7-19(27)20(28)9-14/h3-10,29,32H,11-13H2,1-2H3

Standard InChI Key:  OCBUDARWYXQUQC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   32.2553   -6.7855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9701   -7.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6837   -5.9546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.6825   -6.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3955   -7.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1141   -6.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1153   -5.9566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.3978   -5.5391    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3932   -8.0210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8274   -7.1995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.8288   -5.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5426   -5.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2576   -5.5547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2601   -4.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5416   -4.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8295   -4.7272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1149   -4.3149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   35.1147   -3.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9749   -4.3171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.6890   -4.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2558   -5.9433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9652   -5.5346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.9659   -4.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2589   -4.3088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5495   -4.7176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5472   -5.5378    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.2607   -3.4838    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   31.5472   -3.0698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5491   -2.2448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2674   -1.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.2696   -1.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5555   -0.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8378   -1.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.8391   -1.8338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.5563    0.2373    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   32.9853   -0.6001    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 21  1  2  0
  1  2  1  0
  2  4  2  0
  3 22  2  0
  3  4  1  0
  3  8  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  5  9  2  0
  6 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 11  1  0
 16 17  1  0
 17 18  1  0
 14 19  1  0
 19 20  1  0
 21 22  1  0
 21 26  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 24 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 29  1  0
 32 35  1  0
 31 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4859240

    ---

Associated Targets(Human)

RPMI-8226 (44974 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.38Molecular Weight (Monoisotopic): 528.0855AlogP: 5.35#Rotatable Bonds: 6
Polar Surface Area: 93.40Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.94CX Basic pKa: 5.18CX LogP: 4.23CX LogD: 4.21
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -0.12

References

1. Hou Y, Kuang W, Min W, Liu Z, Zhang F, Yuan K, Wang X, Sun C, Cheng H, Wang L, Xiao Y, Pu S, Xin GZ, Yang P..  (2021)  Design, Synthesis, and Biological Evaluation of Icaritin Derivatives as Novel Putative DEPTOR Inhibitors for Multiple Myeloma Treatment.,  64  (20.0): [PMID:34644502] [10.1021/acs.jmedchem.1c00087]

Source