2-(7-(4-(1-(1,2,5-trioxaspiro[5.5]undecan-3-yl)vinyl)phenoxy)naphthalen-2-yloxy)ethanol

ID: ALA4859247

PubChem CID: 44235989

Max Phase: Preclinical

Molecular Formula: C28H30O6

Molecular Weight: 462.54

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(Oc2ccc3ccc(OCCO)cc3c2)cc1)C1COC2(CCCCC2)OO1

Standard InChI:  InChI=1S/C28H30O6/c1-20(27-19-31-28(34-33-27)13-3-2-4-14-28)21-5-9-24(10-6-21)32-26-12-8-22-7-11-25(30-16-15-29)17-23(22)18-26/h5-12,17-18,27,29H,1-4,13-16,19H2

Standard InChI Key:  VBMLFXIOLNDZQS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   11.2508   -7.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9566   -7.6436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6594   -7.2390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6626   -6.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9569   -6.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2479   -6.4218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7680   -7.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7668   -8.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4749   -8.5089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4731   -6.8715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1817   -7.2768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1824   -8.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8910   -8.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5992   -8.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5945   -7.2699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8854   -6.8666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0601   -6.8720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3525   -7.2807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6447   -6.8723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0692   -7.2811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2997   -6.8570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0099   -7.2613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0103   -8.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7196   -8.4823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4258   -8.0693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4182   -7.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7083   -6.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1365   -8.4727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1426   -9.2898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8412   -8.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5484   -8.4648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2510   -8.0544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5385   -6.8314    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8298   -7.2434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  7  8  2  0
  8  9  1  0
  9 12  2  0
 11 10  2  0
 10  7  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  7 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 15 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 30 34  1  0
 31 32  1  0
 32  1  1  0
  1 33  1  0
 33 34  1  0
M  END

Associated Targets(non-human)

Plasmodium yoelii (6656 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 462.54Molecular Weight (Monoisotopic): 462.2042AlogP: 6.02#Rotatable Bonds: 7
Polar Surface Area: 66.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.88CX LogD: 5.88
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: 0.39

References

1. Shukla M, Hassam M, Kumar Yadav D, Sharma S, Singh C, Puri SK, Shrivastava R, Prakash Verma V..  (2021)  Synthesis of novel 1,2,4-trioxanes and antimalarial evaluation against multidrug-resistant Plasmodium yoelii nigeriensis.,  49  [PMID:34365007] [10.1016/j.bmcl.2021.128305]

Source