(S)-1-((1R,2S,4S)-7-oxabicyclo[2.2.1]heptane-2-carbonyl)-N-((S)-1-(imidazo[1,2-a]pyrazin-8-yl)pyrrolidin-3-yl)azepane-4-carboxamide

ID: ALA4859270

PubChem CID: 164615986

Max Phase: Preclinical

Molecular Formula: C24H32N6O3

Molecular Weight: 452.56

Molecule Type: Unknown

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(N[C@H]1CCN(c2nccn3ccnc23)C1)[C@H]1CCCN(C(=O)[C@H]2C[C@@H]3CC[C@H]2O3)CC1

Standard InChI:  InChI=1S/C24H32N6O3/c31-23(27-17-6-11-30(15-17)22-21-25-7-12-28(21)13-8-26-22)16-2-1-9-29(10-5-16)24(32)19-14-18-3-4-20(19)33-18/h7-8,12-13,16-20H,1-6,9-11,14-15H2,(H,27,31)/t16-,17-,18-,19-,20+/m0/s1

Standard InChI Key:  BPFXGFIUYTXZRN-VYJAJWGXSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   43.4915   -3.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.3087   -3.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.5631   -2.9233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   43.9001   -2.4412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.2414   -2.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.3315   -2.6749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.9344   -3.2220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   46.7091   -2.9735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.8844   -2.1749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2784   -1.6252    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   45.4973   -1.8740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.2802   -0.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.5087   -0.5609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.0302   -1.2166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   42.4641   -2.6711    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   41.8570   -3.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.0797   -2.9661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.0273   -4.0175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.9597   -2.1280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.2641   -1.7348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5066   -3.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.6964   -3.4614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.2444   -2.7405    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   39.5058   -2.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4289   -2.7931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9756   -2.1132    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   38.0667   -3.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2508   -3.5762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.8884   -4.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.3384   -4.9872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1550   -4.9365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.5216   -4.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6486   -4.3175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.1499   -2.7614    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   38.9583   -5.0538    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  3  6  1  0
  6  7  2  0
  6 11  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  2  0
 13 14  1  0
 14 11  2  0
  5 15  1  6
 15 16  1  0
 17 16  1  6
 16 18  2  0
 17 19  1  0
 19 20  1  0
 17 21  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
 21 22  1  0
 23 25  1  0
 25 26  2  0
 27 25  1  1
 27 28  1  0
 27 32  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 28 33  1  0
 28 34  1  1
 31 35  1  1
M  END

Alternative Forms

  1. Parent:

    ALA4859270

    ---

Associated Targets(Human)

ACKR3 Tchem C-X-C chemokine receptor type 7 (1102 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2536AlogP: 1.62#Rotatable Bonds: 4
Polar Surface Area: 92.07Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.65CX LogP: 0.03CX LogD: 0.03
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.76Np Likeness Score: -1.25

References

1. Aspnes GE, Menhaji-Klotz E, Boehm M, Londregan AT, Lee ECY, Limberakis C, Coffey SB, Brown JA, Jones RM, Hesp KD..  (2021)  Discovery and evaluation of non-basic small molecule modulators of the atypical chemokine receptor CXCR7.,  50  [PMID:34400299] [10.1016/j.bmcl.2021.128320]

Source