The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(dimethylamino)-2-oxoethyl 4-(4-(5-(hydroxymethyl)isoxazol-3-yl)phenyl)-7-(4-(trifluoromethyl)phenyl)-2-naphthoate ID: ALA4859308
PubChem CID: 164585623
Max Phase: Preclinical
Molecular Formula: C32H25F3N2O5
Molecular Weight: 574.56
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)C(=O)COC(=O)c1cc(-c2ccc(-c3cc(CO)on3)cc2)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2c1
Standard InChI: InChI=1S/C32H25F3N2O5/c1-37(2)30(39)18-41-31(40)24-14-23-13-22(19-7-10-25(11-8-19)32(33,34)35)9-12-27(23)28(15-24)20-3-5-21(6-4-20)29-16-26(17-38)42-36-29/h3-16,38H,17-18H2,1-2H3
Standard InChI Key: GIRVJXOQPFDKOE-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
17.4308 -6.2583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7260 -5.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2119 -4.8579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6259 -6.3869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1099 -5.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4032 -4.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8879 -4.3553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0794 -4.4846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7888 -5.2536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3059 -5.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5333 -5.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0467 -6.0028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8272 -4.6045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.3369 -7.1494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5288 -7.2780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2377 -8.0408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7538 -8.6756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5643 -8.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8517 -7.7798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5662 -3.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8581 -3.0886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3425 -2.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5348 -2.5858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2455 -3.3546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7630 -3.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0176 -1.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3069 -1.1889 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.2111 -2.0847 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.4353 -1.3702 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.4639 -9.4361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6345 -4.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9283 -3.7152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7356 -3.5885 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0295 -2.8260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2491 -4.2243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4149 -3.0795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6823 -9.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6416 -10.4617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4022 -10.7516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9127 -10.1178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9574 -10.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2283 -10.5392 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 5 1 0
2 11 1 0
11 12 2 0
11 13 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
4 14 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
8 20 1 0
23 26 1 0
26 27 1 0
26 28 1 0
26 29 1 0
17 30 1 0
13 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
33 35 1 0
32 36 2 0
30 37 1 0
37 38 2 0
38 39 1 0
39 40 1 0
40 30 2 0
38 41 1 0
41 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 574.56Molecular Weight (Monoisotopic): 574.1716AlogP: 6.58#Rotatable Bonds: 7Polar Surface Area: 92.87Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.31CX Basic pKa: ┄CX LogP: 5.81CX LogD: 5.81Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.22Np Likeness Score: -0.88
References 1. Jung YH, Salmaso V, Wen Z, Bennett JM, Phung NB, Lieberman DI, Gopinatth V, Randle JCR, Chen Z, Salvemini D, Karcz TP, Cook DN, Jacobson KA.. (2021) Structure-Activity Relationship of Heterocyclic P2Y14 Receptor Antagonists: Removal of the Zwitterionic Character with Piperidine Bioisosteres., 64 (8.0): [PMID:33787273 ] [10.1021/acs.jmedchem.1c00164 ]