4-(3-(4-(dimethylamino)-2-(phenylamino)thiazol-5-yl)-2-(ethoxycarbonyl)-3-oxoprop-1-enyl)phenylboronic acid

ID: ALA4859336

PubChem CID: 164615996

Max Phase: Preclinical

Molecular Formula: C23H24BN3O5S

Molecular Weight: 465.34

Molecule Type: Unknown

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C(=C\c1ccc(B(O)O)cc1)C(=O)c1sc(Nc2ccccc2)nc1N(C)C

Standard InChI:  InChI=1S/C23H24BN3O5S/c1-4-32-22(29)18(14-15-10-12-16(13-11-15)24(30)31)19(28)20-21(27(2)3)26-23(33-20)25-17-8-6-5-7-9-17/h5-14,30-31H,4H2,1-3H3,(H,25,26)/b18-14-

Standard InChI Key:  CSUGMTOOLJPXJN-JXAWBTAJSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    4.2442   -3.3582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2431   -4.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9579   -4.5984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6743   -4.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6715   -3.3545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9561   -2.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3843   -2.9393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1004   -3.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1934   -4.1682    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0000   -4.3369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4107   -3.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8564   -3.0098    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    9.2309   -3.5312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7184   -4.1968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5635   -2.7763    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3857   -4.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5385   -4.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0259   -4.7729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8712   -3.3524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8461   -4.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3336   -5.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8732   -5.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5355   -6.3703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0221   -7.0354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8432   -6.9463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1751   -6.1865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6864   -5.5245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3316   -7.6113    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0
   11.0000   -8.3666    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1515   -7.5207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1176   -5.1534    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4692   -5.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8835   -5.4599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  8  1  0
 11 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 14 17  1  0
 17 18  1  0
 17 19  2  0
 18 20  1  0
 20 21  1  0
 16 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 25 28  1  0
 28 29  1  0
 28 30  1  0
 10 31  1  0
 31 32  1  0
 31 33  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA4859336

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Unknown

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 465.34

Molecular Weight (Monoisotopic): 465.1530

AlogP: ┄

#Rotatable Bonds: ┄

Polar Surface Area: ┄

Molecular Species: ┄

HBA: ┄

HBD: ┄

#RO5 Violations: ┄

HBA (Lipinski): ┄

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): ┄

CX Acidic pKa: ┄

CX Basic pKa: ┄

CX LogP: ┄

CX LogD: ┄

Aromatic Rings: ┄

Heavy Atoms: ┄

QED Weighted: ┄

Np Likeness Score: ┄

References

1. Patle R, Shinde S, Patel S, Maheshwari R, Jariyal H, Srivastava A, Chauhan N, Globisch C, Jain A, Tekade RK, Shard A..  (2021)  Discovery of boronic acid-based potent activators of tumor pyruvate kinase M2 and development of gastroretentive nanoformulation for oral dosing.,  42  [PMID:33901643] [10.1016/j.bmcl.2021.128062]

Source

Source(1):

• Scientific Literature