N-((3R,4R,5S,6R)-2,4-dihydroxy-6-(hydroxymethyl)-5-((2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yloxy)tetrahydro-2H-pyran-3-yl)acetamide

ID: ALA4859399

Cas Number: 32181-59-2

PubChem CID: 9800166

Product Number: S115550, Order Now?

Max Phase: Preclinical

Molecular Formula: C14H25NO11

Molecular Weight: 383.35

Molecule Type: Unknown

Associated Items:

This product is in stock

Names and Identifiers

Canonical SMILES:  CC(=O)N[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H]1O

Standard InChI:  InChI=1S/C14H25NO11/c1-4(18)15-7-9(20)12(6(3-17)24-13(7)23)26-14-11(22)10(21)8(19)5(2-16)25-14/h5-14,16-17,19-23H,2-3H2,1H3,(H,15,18)/t5-,6-,7-,8+,9-,10+,11-,12-,13?,14+/m1/s1

Standard InChI Key:  KFEUJDWYNGMDBV-RPHKZZMBSA-N

Molfile:  

 
     RDKit          2D

 27 28  0  0  0  0  0  0  0  0999 V2000
   35.5455  -13.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5455  -14.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2575  -15.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9694  -14.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.9694  -13.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.2575  -13.3874    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.6851  -13.3936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.2575  -15.8624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8298  -13.3936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6834  -15.0425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.8316  -15.0425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.8274  -12.5686    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.1166  -14.6311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.1176  -13.8074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4066  -13.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6903  -13.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.6896  -14.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4050  -15.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.4064  -15.8730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   31.9743  -15.0431    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   33.4086  -12.5711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.9768  -13.3919    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   32.6950  -12.1568    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.3288  -15.4248    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   37.6822  -15.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.3960  -16.2810    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   36.9671  -16.2790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  3  8  1  1
  1  9  1  1
  4 10  1  6
  2 11  1  6
  9 12  1  0
 13 11  1  0
 13 14  1  0
 13 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  6
 17 20  1  1
 15 21  1  1
 16 22  1  1
 21 23  1  0
 13 24  1  6
 10 25  1  0
 25 26  2  0
 25 27  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

LGALS1 Tchem Galectin-1 (387 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 383.35Molecular Weight (Monoisotopic): 383.1428AlogP: -5.25#Rotatable Bonds: 5
Polar Surface Area: 198.40Molecular Species: NEUTRALHBA: 11HBD: 8
#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.50CX Basic pKa: CX LogP: -4.99CX LogD: -4.99
Aromatic Rings: Heavy Atoms: 26QED Weighted: 0.23Np Likeness Score: 2.03

References

1. Porciúncula-González C, Cagnoni AJ, Fontana C, Mariño KV, Saenz-Méndez P, Giacomini C, Irazoqui G..  (2021)  Structural insights in galectin-1-glycan recognition: Relevance of the glycosidic linkage and the N-acetylation pattern of sugar moieties.,  44  [PMID:34293617] [10.1016/j.bmc.2021.116309]

Source