3-((4-(Benzyloxy)-3-chlorophenyl)amino)-4-(2-methoxyphenyl)-1H-pyrrole-2,5-dione

ID: ALA4859423

PubChem CID: 164616016

Max Phase: Preclinical

Molecular Formula: C24H19ClN2O4

Molecular Weight: 434.88

Molecule Type: Unknown

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1C1=C(Nc2ccc(OCc3ccccc3)c(Cl)c2)C(=O)NC1=O

Standard InChI:  InChI=1S/C24H19ClN2O4/c1-30-19-10-6-5-9-17(19)21-22(24(29)27-23(21)28)26-16-11-12-20(18(25)13-16)31-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H2,26,27,28,29)

Standard InChI Key:  UKFZPGOREAWYIK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   21.3367   -7.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1539   -7.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4083   -7.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7453   -6.6934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.0866   -7.1755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9122   -8.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0929   -8.6307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6679   -9.3292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0610  -10.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8836  -10.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3049   -9.3648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6335   -8.6139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   23.4468   -8.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8519   -9.3200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6645   -9.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.8491   -7.9119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1858   -6.9241    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.3093   -6.9233    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7012   -7.9135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8842   -7.8942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.6603   -7.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0736   -8.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8887   -8.6146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.2966   -7.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1138   -7.9058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5183   -8.6146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3348   -8.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.7436   -7.9056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.3299   -7.1959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5149   -7.1998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0654   -7.1987    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  6  1  1  0
  2 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 22  2  0
 21 16  2  0
 16 13  1  0
  3 17  2  0
  5 18  2  0
  7 19  1  0
 19 20  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 21 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA4859423

    ---

Associated Targets(Human)

SLK Tchem Serine/threonine-protein kinase 2 (1640 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
STK10 Tchem Serine/threonine-protein kinase 10 (2119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 434.88Molecular Weight (Monoisotopic): 434.1033AlogP: 4.41#Rotatable Bonds: 7
Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 9.69CX Basic pKa: CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.52

References

1. Serafim RAM, Sorrell FJ, Berger BT, Collins RJ, Vasconcelos SNS, Massirer KB, Knapp S, Bennett J, Fedorov O, Patel H, Zuercher WJ, Elkins JM..  (2021)  Discovery of a Potent Dual SLK/STK10 Inhibitor Based on a Maleimide Scaffold.,  64  (18.0): [PMID:34463505] [10.1021/acs.jmedchem.0c01579]

Source