The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-((4-(Benzyloxy)-3-chlorophenyl)amino)-4-(2-methoxyphenyl)-1H-pyrrole-2,5-dione ID: ALA4859423
PubChem CID: 164616016
Max Phase: Preclinical
Molecular Formula: C24H19ClN2O4
Molecular Weight: 434.88
Molecule Type: Unknown
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1C1=C(Nc2ccc(OCc3ccccc3)c(Cl)c2)C(=O)NC1=O
Standard InChI: InChI=1S/C24H19ClN2O4/c1-30-19-10-6-5-9-17(19)21-22(24(29)27-23(21)28)26-16-11-12-20(18(25)13-16)31-14-15-7-3-2-4-8-15/h2-13H,14H2,1H3,(H2,26,27,28,29)
Standard InChI Key: UKFZPGOREAWYIK-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
21.3367 -7.9522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1539 -7.9522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4083 -7.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7453 -6.6934 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.0866 -7.1755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.9122 -8.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0929 -8.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6679 -9.3292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0610 -10.0480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8836 -10.0640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.3049 -9.3648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6335 -8.6139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
23.4468 -8.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8519 -9.3200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6645 -9.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.8491 -7.9119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1858 -6.9241 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.3093 -6.9233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7012 -7.9135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.8842 -7.8942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.6603 -7.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0736 -8.6153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.8887 -8.6146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
26.2966 -7.9065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.1138 -7.9058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5183 -8.6146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3348 -8.6142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.7436 -7.9056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.3299 -7.1959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.5149 -7.1998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.0654 -7.1987 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 6 1 0
6 1 1 0
2 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 22 2 0
21 16 2 0
16 13 1 0
3 17 2 0
5 18 2 0
7 19 1 0
19 20 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
21 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: UnknownTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 434.88Molecular Weight (Monoisotopic): 434.1033AlogP: 4.41#Rotatable Bonds: 7Polar Surface Area: 76.66Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.69CX Basic pKa: ┄CX LogP: 3.96CX LogD: 3.96Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.54Np Likeness Score: -0.52
References 1. Serafim RAM, Sorrell FJ, Berger BT, Collins RJ, Vasconcelos SNS, Massirer KB, Knapp S, Bennett J, Fedorov O, Patel H, Zuercher WJ, Elkins JM.. (2021) Discovery of a Potent Dual SLK/STK10 Inhibitor Based on a Maleimide Scaffold., 64 (18.0): [PMID:34463505 ] [10.1021/acs.jmedchem.0c01579 ]